/* This Source Code Form is subject to the terms of the Mozilla Public * License, v. 2.0. If a copy of the MPL was not distributed with this * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ "use strict"; const { EXPAND_TAB, TAB_SIZE, DETECT_INDENT, getIndentationFromIteration, } = require("resource://devtools/shared/indentation.js"); const { debounce } = require("resource://devtools/shared/debounce.js"); const nodeConstants = require("resource://devtools/shared/dom-node-constants.js"); const ENABLE_CODE_FOLDING = "devtools.editor.enableCodeFolding"; const KEYMAP_PREF = "devtools.editor.keymap"; const AUTO_CLOSE = "devtools.editor.autoclosebrackets"; const AUTOCOMPLETE = "devtools.editor.autocomplete"; const CARET_BLINK_TIME = "ui.caretBlinkTime"; const XHTML_NS = "http://www.w3.org/1999/xhtml"; const VALID_KEYMAPS = new Map([ [ "emacs", "chrome://devtools/content/shared/sourceeditor/codemirror/keymap/emacs.js", ], [ "vim", "chrome://devtools/content/shared/sourceeditor/codemirror/keymap/vim.js", ], [ "sublime", "chrome://devtools/content/shared/sourceeditor/codemirror/keymap/sublime.js", ], ]); // Maximum allowed margin (in number of lines) from top or bottom of the editor // while shifting to a line which was initially out of view. const MAX_VERTICAL_OFFSET = 3; const RE_JUMP_TO_LINE = /^(\d+):?(\d+)?/; const AUTOCOMPLETE_MARK_CLASSNAME = "cm-auto-complete-shadow-text"; const EventEmitter = require("resource://devtools/shared/event-emitter.js"); const { PrefObserver } = require("resource://devtools/client/shared/prefs.js"); const KeyShortcuts = require("resource://devtools/client/shared/key-shortcuts.js"); const { LocalizationHelper } = require("resource://devtools/shared/l10n.js"); const L10N = new LocalizationHelper( "devtools/client/locales/sourceeditor.properties" ); loader.lazyRequireGetter( this, "wasm", "resource://devtools/client/shared/sourceeditor/wasm.js" ); loader.lazyRequireGetter( this, "scopeUtils", "resource://devtools/client/shared/sourceeditor/scope-utils.js" ); loader.lazyRequireGetter( this, "lezerUtils", "resource://devtools/client/shared/sourceeditor/lezer-utils.js" ); const { OS } = Services.appinfo; // CM_BUNDLE and CM_IFRAME represent the HTML and JavaScript that is // injected into an iframe in order to initialize a CodeMirror instance. const CM_BUNDLE = "chrome://devtools/content/shared/sourceeditor/codemirror/codemirror.bundle.js"; const CM_IFRAME = "chrome://devtools/content/shared/sourceeditor/codemirror/cmiframe.html"; const CM_MAPPING = [ "clearHistory", "defaultCharWidth", "extendSelection", "getCursor", "getLine", "getScrollInfo", "getSelection", "getViewport", "hasFocus", "lineCount", "openDialog", "redo", "refresh", "replaceSelection", "setSelection", "somethingSelected", "undo", ]; const ONLY_SPACES_REGEXP = /^\s*$/; const PREF_CMNEXT_ENABLED = "devtools.webconsole.codemirrorNext"; const editors = new WeakMap(); /** * A very thin wrapper around CodeMirror. Provides a number * of helper methods to make our use of CodeMirror easier and * another method, appendTo, to actually create and append * the CodeMirror instance. * * Note that Editor doesn't expose CodeMirror instance to the * outside world. * * Constructor accepts one argument, config. It is very * similar to the CodeMirror configuration object so for most * properties go to CodeMirror's documentation (see below). * * Other than that, it accepts one additional and optional * property contextMenu. This property should be an element, or * an ID of an element that we can use as a context menu. * * This object is also an event emitter. * * CodeMirror docs: http://codemirror.net/doc/manual.html */ class Editor extends EventEmitter { // Static methods on the Editor object itself. /** * Returns a string representation of a shortcut 'key' with * a OS specific modifier. Cmd- for Macs, Ctrl- for other * platforms (in cm5). For cm6 Mod- is used instead. Useful with extraKeys configuration option. * * CodeMirror defines all keys with modifiers in the following * order: Shift - Ctrl/Cmd - Alt - Key */ static accel(key, modifiers = {}) { const osShortcut = Services.appinfo.OS == "Darwin" ? "Cmd-" : "Ctrl-"; return ( (modifiers.shift ? "Shift-" : "") + (Services.prefs.getBoolPref(PREF_CMNEXT_ENABLED) ? "Mod-" : osShortcut) + (modifiers.alt ? "Alt-" : "") + key ); } /** * Returns a string representation of a shortcut for a * specified command 'cmd'. Append Cmd- for macs, Ctrl- for other * platforms unless noaccel is specified in the options. Useful when overwriting * or disabling default shortcuts. */ static keyFor(cmd, opts = { noaccel: false }) { const key = L10N.getStr(cmd + ".commandkey"); return opts.noaccel ? key : Editor.accel(key); } /** * This maps key binding from the Codemirror 5 format (an Object) to the Codemirror 6 * expected format (an Array). * * @param {object} keyBindings * @returns {Array} */ static mapKeyBindings(keyBindings) { // Key Events which have different key values from CM5 and CM6 const keyEvents = { Up: "ArrowUp", Down: "ArrowDown", Left: "ArrowLeft", Right: "ArrowRight", }; const keyBindingsArr = []; for (const key in keyBindings) { if (typeof keyBindings[key] == "function") { keyBindingsArr.push({ key: keyEvents[key] ? keyEvents[key] : key, run: keyBindings[key], }); } } return keyBindingsArr; } static modes = { cljs: { name: "text/x-clojure" }, css: { name: "css" }, fs: { name: "x-shader/x-fragment" }, haxe: { name: "haxe" }, http: { name: "http" }, html: { name: "htmlmixed" }, xml: { name: "xml" }, javascript: { name: "javascript" }, json: { name: "json" }, text: { name: "text" }, vs: { name: "x-shader/x-vertex" }, wasm: { name: "wasm" }, }; markerTypes = { /* Line Markers */ CONDITIONAL_BP_MARKER: "conditional-breakpoint-panel-marker", TRACE_MARKER: "trace-panel-marker", DEBUG_LINE_MARKER: "debug-line-marker", LINE_EXCEPTION_MARKER: "line-exception-marker", HIGHLIGHT_LINE_MARKER: "highlight-line-marker", MULTI_HIGHLIGHT_LINE_MARKER: "multi-highlight-line-marker", BLACKBOX_LINE_MARKER: "blackbox-line-marker", INLINE_PREVIEW_MARKER: "inline-preview-marker", /* Position Markers */ COLUMN_BREAKPOINT_MARKER: "column-breakpoint-marker", DEBUG_POSITION_MARKER: "debug-position-marker", EXCEPTION_POSITION_MARKER: "exception-position-marker", ACTIVE_SELECTION_MARKER: "active-selection-marker", PAUSED_LOCATION_MARKER: "paused-location-marker", /* Gutter Markers */ EMPTY_LINE_MARKER: "empty-line-marker", BLACKBOX_LINE_GUTTER_MARKER: "blackbox-line-gutter-marker", GUTTER_BREAKPOINT_MARKER: "gutter-breakpoint-marker", }; container = null; version = null; config = null; Doc = null; searchState = { cursors: [], currentCursorIndex: -1, query: "", }; #abortController; // The id for the current source in the editor (selected source). This is used to: // * cache the scroll snapshot for tracking scroll positions and the symbols, // * know when an actual source is displayed (and not only a loading/error message) #currentDocumentId = null; #currentDocument = null; #CodeMirror6; #compartments; #effects; #lastDirty; #loadedKeyMaps; #ownerDoc; #prefObserver; #win; #lineGutterMarkers = new Map(); #lineContentMarkers = new Map(); #posContentMarkers = new Map(); #editorDOMEventHandlers = {}; #gutterDOMEventHandlers = {}; // A cache of all the scroll snapshots for the all the sources that // are currently open in the editor. The keys for the Map are the id's // for the source and the values are the scroll snapshots for the sources. #scrollSnapshots = new Map(); #updateListener = null; #beforeUpdateListener = null; // This stores the language support objects used to syntax highlight code, // These are keyed of the modes. #languageModes = new Map(); #sources = new Map(); constructor(config) { super(); const tabSize = Services.prefs.getIntPref(TAB_SIZE); const useTabs = !Services.prefs.getBoolPref(EXPAND_TAB); const useAutoClose = Services.prefs.getBoolPref(AUTO_CLOSE); this.version = null; this.config = { cm6: false, value: "", mode: Editor.modes.text, indentUnit: tabSize, tabSize, contextMenu: null, matchBrackets: true, highlightSelectionMatches: { wordsOnly: true, }, extraKeys: {}, indentWithTabs: useTabs, inputStyle: "accessibleTextArea", // This is set to the biggest value for setTimeout (See https://developer.mozilla.org/en-US/docs/Web/API/WindowOrWorkerGlobalScope/setTimeout#Maximum_delay_value) // This is because codeMirror queries the underlying textArea for some things that // can't be retrieved with events in some browser (but we're fine in Firefox). pollInterval: Math.pow(2, 31) - 1, styleActiveLine: true, autoCloseBrackets: "()[]{}''\"\"``", autoCloseEnabled: useAutoClose, theme: "mozilla", themeSwitching: true, autocomplete: false, autocompleteOpts: {}, // Expect a CssProperties object (see devtools/client/fronts/css-properties.js) cssProperties: null, // Set to `true` to prevent the search addon to be activated. disableSearchAddon: false, // When the search addon is activated (i.e disableSearchAddon == false), // `useSearchAddonPanel` determines if the default search panel for the search addon should be used. // Set to `false` when a custom search panel is used. // Note: This can probably be removed when Bug 1941575 is fixed, and custom search panel is used everywhere useSearchAddonPanel: true, maxHighlightLength: 1000, // Disable codeMirror setTimeout-based cursor blinking (will be replaced by a CSS animation) cursorBlinkRate: 0, // List of non-printable chars that will be displayed in the editor, showing their // unicode version. We only add a few characters to the default list: // - \u202d LEFT-TO-RIGHT OVERRIDE // - \u202e RIGHT-TO-LEFT OVERRIDE // - \u2066 LEFT-TO-RIGHT ISOLATE // - \u2067 RIGHT-TO-LEFT ISOLATE // - \u2069 POP DIRECTIONAL ISOLATE specialChars: // eslint-disable-next-line no-control-regex /[\u0000-\u001f\u007f-\u009f\u00ad\u061c\u200b-\u200f\u2028\u2029\u202d\u202e\u2066\u2067\u2069\ufeff\ufff9-\ufffc]/, specialCharPlaceholder: char => { // Use the doc provided to the setup function if we don't have a reference to a codeMirror // editor yet (this can happen when an Editor is being created with existing content) const doc = this.#ownerDoc; const el = doc.createElement("span"); el.classList.add("cm-non-printable-char"); el.append(doc.createTextNode(`\\u${char.codePointAt(0).toString(16)}`)); return el; }, // In CodeMirror 5, adds a `CodeMirror-selectedtext` class on selected text that // can be used to set the selected text color, which isn't possible by default. // This is especially useful for High Contrast Mode where we do need to adjust the // selection text color styleSelectedText: true, }; // Additional shortcuts. this.config.extraKeys[Editor.keyFor("jumpToLine")] = () => this.jumpToLine(); this.config.extraKeys[Editor.keyFor("moveLineUp", { noaccel: true })] = () => this.moveLineUp(); this.config.extraKeys[Editor.keyFor("moveLineDown", { noaccel: true })] = () => this.moveLineDown(); this.config.extraKeys[Editor.keyFor("toggleComment")] = "toggleComment"; // Disable ctrl-[ and ctrl-] because toolbox uses those shortcuts. this.config.extraKeys[Editor.keyFor("indentLess")] = false; this.config.extraKeys[Editor.keyFor("indentMore")] = false; // Disable Alt-B and Alt-F to navigate groups (respectively previous and next) since: // - it's not standard in input fields // - it also inserts a character which feels weird this.config.extraKeys["Alt-B"] = false; this.config.extraKeys["Alt-F"] = false; // Disable Ctrl/Cmd + U as it's used for "View Source". It's okay to disable Ctrl+U as // the underlying command, `undoSelection`, isn't standard in input fields and isn't // widely known. this.config.extraKeys[Editor.accel("U")] = false; if (!config.disableSearchAddon) { // Override the default search shortcut so the built-in UI doesn't get hidden // when hitting Enter (so the user can cycle through results). this.config.extraKeys[Editor.accel("F")] = () => editors.get(this).execCommand("findPersistent"); } // Disable keys that trigger events with a null-string `which` property. // It looks like some of those (e.g. the Function key), can trigger a poll // which fails to see that there's a selection, which end up replacing the // selected text with an empty string. // TODO: We should investigate the root cause. this.config.extraKeys["'\u0000'"] = false; // Overwrite default config with user-provided, if needed. Object.keys(config).forEach(k => { if (k != "extraKeys") { this.config[k] = config[k]; return; } if (!config.extraKeys) { return; } Object.keys(config.extraKeys).forEach(key => { this.config.extraKeys[key] = config.extraKeys[key]; }); }); if (!this.config.gutters) { this.config.gutters = []; } if ( this.config.lineNumbers && !this.config.gutters.includes("CodeMirror-linenumbers") ) { this.config.gutters.push("CodeMirror-linenumbers"); } // Remember the initial value of autoCloseBrackets. this.config.autoCloseBracketsSaved = this.config.autoCloseBrackets; // If the tab behaviour is not explicitly set to `false` from the config, set a tab behavior. // If something is selected, indent those lines. If nothing is selected and we're // indenting with tabs, insert one tab. Otherwise insert N // whitespaces where N == indentUnit option. if (this.config.extraKeys.Tab !== false) { this.config.extraKeys.Tab = cm => { if (config.extraKeys?.Tab) { // If a consumer registers its own extraKeys.Tab, we execute it before doing // anything else. If it returns false, that mean that all the key handling work is // done, so we can do an early return. const res = config.extraKeys.Tab(cm); if (res === false) { return; } } if (cm.somethingSelected()) { cm.indentSelection("add"); return; } if (this.config.indentWithTabs) { cm.replaceSelection("\t", "end", "+input"); return; } let num = cm.getOption("indentUnit"); if (cm.getCursor().ch !== 0) { num -= cm.getCursor().ch % num; } cm.replaceSelection(" ".repeat(num), "end", "+input"); }; if (this.config.cssProperties) { // Ensure that autocompletion has cssProperties if it's passed in via the options. this.config.autocompleteOpts.cssProperties = this.config.cssProperties; } } } /** * Exposes the CodeMirror class. We want to be able to * invoke static commands such as runMode for syntax highlighting. */ get CodeMirror() { const codeMirror = editors.get(this); return codeMirror?.constructor; } /** * Exposes the CodeMirror instance. We want to get away from trying to * abstract away the API entirely, and this makes it easier to integrate in * various environments and do complex things. */ get codeMirror() { if (!editors.has(this)) { throw new Error( "CodeMirror instance does not exist. You must wait " + "for it to be appended to the DOM." ); } return editors.get(this); } /** * Return whether there is a CodeMirror instance associated with this Editor. */ get hasCodeMirror() { return editors.has(this); } /** * Appends the current Editor instance to the element specified by * 'el'. You can also provide your own iframe to host the editor as * an optional second parameter. This method actually creates and * loads CodeMirror and all its dependencies. * * This method is asynchronous and returns a promise. */ appendTo(el, env) { return new Promise(resolve => { const cm = editors.get(this); if (!env) { env = el.ownerDocument.createElementNS(XHTML_NS, "iframe"); env.className = "source-editor-frame"; } if (cm) { throw new Error("You can append an editor only once."); } const onLoad = () => { // Prevent flickering by showing the iframe once loaded. // See https://github.com/w3c/csswg-drafts/issues/9624 env.style.visibility = ""; const win = env.contentWindow.wrappedJSObject; this.container = env; const editorEl = win.document.body; const editorDoc = el.ownerDocument; if (this.config.cm6) { this.#setupCm6(editorEl, editorDoc); } else { this.#setup(editorEl, editorDoc); } resolve(); }; env.style.visibility = "hidden"; env.addEventListener("load", onLoad, { capture: true, once: true, signal: this.#abortController?.signal, }); env.src = CM_IFRAME; el.appendChild(env); this.once("destroy", () => el.removeChild(env)); }); } appendToLocalElement(el) { const win = el.ownerDocument.defaultView; this.#abortController = new win.AbortController(); if (this.config.cm6) { this.#setupCm6(el); } else { this.#setup(el); } } // This update listener allows listening to the changes // to the codemiror editor. setUpdateListener(listener = null) { this.#updateListener = listener; } setBeforeUpdateListener(listener = null) { this.#beforeUpdateListener = listener; } /** * Do the actual appending and configuring of the CodeMirror instance. This is * used by both append functions above, and does all the hard work to * configure CodeMirror with all the right options/modes/etc. */ #setup(el, doc) { this.#ownerDoc = doc || el.ownerDocument; const win = el.ownerDocument.defaultView; Services.scriptloader.loadSubScript(CM_BUNDLE, win); this.#win = win; if (this.config.cssProperties) { // Replace the propertyKeywords, colorKeywords and valueKeywords // properties of the CSS MIME type with the values provided by the CSS properties // database. const { propertyKeywords, colorKeywords, valueKeywords } = getCSSKeywords( this.config.cssProperties ); const cssSpec = win.CodeMirror.resolveMode("text/css"); cssSpec.propertyKeywords = propertyKeywords; cssSpec.colorKeywords = colorKeywords; cssSpec.valueKeywords = valueKeywords; win.CodeMirror.defineMIME("text/css", cssSpec); const scssSpec = win.CodeMirror.resolveMode("text/x-scss"); scssSpec.propertyKeywords = propertyKeywords; scssSpec.colorKeywords = colorKeywords; scssSpec.valueKeywords = valueKeywords; win.CodeMirror.defineMIME("text/x-scss", scssSpec); } win.CodeMirror.commands.save = () => this.emit("saveRequested"); // Create a CodeMirror instance add support for context menus, // overwrite the default controller (otherwise items in the top and // context menus won't work). const cm = win.CodeMirror(el, this.config); this.Doc = win.CodeMirror.Doc; // Disable APZ for source editors. It currently causes the line numbers to // "tear off" and swim around on top of the content. Bug 1160601 tracks // finding a solution that allows APZ to work with CodeMirror. cm.getScrollerElement().addEventListener( "wheel", ev => { // By handling the wheel events ourselves, we force the platform to // scroll synchronously, like it did before APZ. However, we lose smooth // scrolling for users with mouse wheels. This seems acceptible vs. // doing nothing and letting the gutter slide around. ev.preventDefault(); let { deltaX, deltaY } = ev; if (ev.deltaMode == ev.DOM_DELTA_LINE) { deltaX *= cm.defaultCharWidth(); deltaY *= cm.defaultTextHeight(); } else if (ev.deltaMode == ev.DOM_DELTA_PAGE) { deltaX *= cm.getWrapperElement().clientWidth; deltaY *= cm.getWrapperElement().clientHeight; } cm.getScrollerElement().scrollBy(deltaX, deltaY); }, { signal: this.#abortController?.signal } ); cm.getWrapperElement().addEventListener( "contextmenu", ev => { if (!this.config.contextMenu) { return; } ev.stopPropagation(); ev.preventDefault(); let popup = this.config.contextMenu; if (typeof popup == "string") { popup = this.#ownerDoc.getElementById(this.config.contextMenu); } this.emit("popupOpen", ev, popup); popup.openPopupAtScreen(ev.screenX, ev.screenY, true); }, { signal: this.#abortController?.signal } ); const pipedEvents = [ "beforeChange", "blur", "changes", "cursorActivity", "focus", "keyHandled", "scroll", ]; for (const eventName of pipedEvents) { cm.on(eventName, (...args) => this.emit(eventName, ...args)); } cm.on("change", () => { this.emit("change"); if (!this.#lastDirty) { this.#lastDirty = true; this.emit("dirty-change"); } }); cm.on("gutterClick", (cmArg, line, gutter, ev) => { const lineOrOffset = !this.isWasm ? line : this.lineToWasmOffset(line); this.emit("gutterClick", lineOrOffset, ev.button); }); win.CodeMirror.defineExtension("l10n", name => { return L10N.getStr(name); }); if (!this.config.disableSearchAddon) { this.#initSearchShortcuts(win); } else { // Hotfix for Bug 1527898. We should remove those overrides as part of Bug 1527903. Object.assign(win.CodeMirror.commands, { find: null, findPersistent: null, findPersistentNext: null, findPersistentPrev: null, findNext: null, findPrev: null, clearSearch: null, replace: null, replaceAll: null, }); } // Retrieve the cursor blink rate from user preference, or fall back to CodeMirror's // default value. let cursorBlinkingRate = win.CodeMirror.defaults.cursorBlinkRate; if (Services.prefs.prefHasUserValue(CARET_BLINK_TIME)) { cursorBlinkingRate = Services.prefs.getIntPref( CARET_BLINK_TIME, cursorBlinkingRate ); } // This will be used in the animation-duration property we set on the cursor to // implement the blinking animation. If cursorBlinkingRate is 0 or less, the cursor // won't blink. cm.getWrapperElement().style.setProperty( "--caret-blink-time", `${Math.max(0, cursorBlinkingRate)}ms` ); editors.set(this, cm); this.reloadPreferences = this.reloadPreferences.bind(this); this.setKeyMap = this.setKeyMap.bind(this, win); this.#prefObserver = new PrefObserver("devtools.editor."); this.#prefObserver.on(TAB_SIZE, this.reloadPreferences); this.#prefObserver.on(EXPAND_TAB, this.reloadPreferences); this.#prefObserver.on(AUTO_CLOSE, this.reloadPreferences); this.#prefObserver.on(AUTOCOMPLETE, this.reloadPreferences); this.#prefObserver.on(DETECT_INDENT, this.reloadPreferences); this.#prefObserver.on(ENABLE_CODE_FOLDING, this.reloadPreferences); this.reloadPreferences(); // Init a map of the loaded keymap files. Should be of the form MapBoolean>. this.#loadedKeyMaps = new Set(); this.#prefObserver.on(KEYMAP_PREF, this.setKeyMap); this.setKeyMap(); win.editor = this; const editorReadyEvent = new win.CustomEvent("editorReady"); win.dispatchEvent(editorReadyEvent); } #setupLanguageModes() { if (!this.config.cm6) { return; } const { codemirrorLangJavascript, codemirrorLangJson, codemirrorLangHtml, codemirrorLangXml, codemirrorLangCss, } = this.#CodeMirror6; this.#languageModes.set( Editor.modes.javascript, codemirrorLangJavascript.javascript() ); this.#languageModes.set(Editor.modes.json, codemirrorLangJson.json()); this.#languageModes.set(Editor.modes.html, codemirrorLangHtml.html()); this.#languageModes.set(Editor.modes.xml, codemirrorLangXml.xml()); this.#languageModes.set(Editor.modes.css, codemirrorLangCss.css()); } /** * Do the actual appending and configuring of the CodeMirror 6 instance. * This is used by appendTo and appendToLocalElement, and does all the hard work to * configure CodeMirror 6 with all the right options/modes/etc. * This should be kept in sync with #setup. * * @param {Element} el: Element into which the codeMirror editor should be appended. * @param {Document} document: Optional document, if not set, will default to el.ownerDocument */ #setupCm6(el, doc) { this.#ownerDoc = doc || el.ownerDocument; const win = el.ownerDocument.defaultView; this.#win = win; this.#CodeMirror6 = this.#win.ChromeUtils.importESModule( "resource://devtools/client/shared/sourceeditor/codemirror6/codemirror6.bundle.mjs", { global: "current" } ); const { codemirror, codemirrorView: { drawSelection, EditorView, keymap, lineNumbers, placeholder, }, codemirrorState: { EditorState, Compartment, Prec }, codemirrorSearch: { search, searchKeymap, highlightSelectionMatches }, codemirrorLanguage: { syntaxTreeAvailable, indentUnit, codeFolding, syntaxHighlighting, bracketMatching, }, lezerHighlight, } = this.#CodeMirror6; this.#compartments = { tabSizeCompartment: new Compartment(), indentCompartment: new Compartment(), lineWrapCompartment: new Compartment(), lineNumberCompartment: new Compartment(), lineNumberMarkersCompartment: new Compartment(), searchHighlightCompartment: new Compartment(), domEventHandlersCompartment: new Compartment(), foldGutterCompartment: new Compartment(), languageCompartment: new Compartment(), }; const { lineContentMarkerEffect, lineContentMarkerExtension } = this.#createlineContentMarkersExtension(); const { positionContentMarkerEffect, positionContentMarkerExtension } = this.#createPositionContentMarkersExtension(); this.#effects = { lineContentMarkerEffect, positionContentMarkerEffect }; const indentStr = (this.config.indentWithTabs ? "\t" : " ").repeat( this.config.indentUnit || 2 ); // Track the scroll snapshot for the current document at the end of the scroll this.#editorDOMEventHandlers.scroll = [ debounce(this.#cacheScrollSnapshot, 250), ]; this.#setupLanguageModes(); const languageMode = []; if (this.config.mode && this.#languageModes.has(this.config.mode)) { languageMode.push(this.#languageModes.get(this.config.mode)); } const extensions = [ bracketMatching(), this.#compartments.indentCompartment.of(indentUnit.of(indentStr)), this.#compartments.tabSizeCompartment.of( EditorState.tabSize.of(this.config.tabSize) ), this.#compartments.lineWrapCompartment.of( this.config.lineWrapping ? EditorView.lineWrapping : [] ), EditorState.readOnly.of(this.config.readOnly), this.#compartments.lineNumberCompartment.of( this.config.lineNumbers ? lineNumbers() : [] ), codeFolding({ placeholderText: "↔", }), this.#compartments.foldGutterCompartment.of( this.config.enableCodeFolding ? this.#foldGutterConfiguration() : [] ), syntaxHighlighting(lezerHighlight.classHighlighter), EditorView.updateListener.of(v => { if (!cm.isDocumentLoadComplete) { // Check that the full syntax tree is available the current viewport if (syntaxTreeAvailable(v.state, v.view.viewState.viewport.to)) { cm.isDocumentLoadComplete = true; } } if (v.viewportChanged || v.docChanged) { if (v.docChanged) { cm.isDocumentLoadComplete = false; } // reset line gutter markers for the new visible ranges // when the viewport changes(e.g when the page is scrolled). if (this.#lineGutterMarkers.size > 0) { this.setLineGutterMarkers(); } } // Any custom defined update listener should be called if (typeof this.#updateListener == "function") { this.#updateListener(v); } }), this.#compartments.domEventHandlersCompartment.of( EditorView.domEventHandlers(this.#createEventHandlers()) ), this.#compartments.lineNumberMarkersCompartment.of([]), lineContentMarkerExtension, positionContentMarkerExtension, this.#compartments.searchHighlightCompartment.of( this.#searchHighlighterExtension([]) ), this.#compartments.languageCompartment.of(languageMode), highlightSelectionMatches(), // keep last so other extension take precedence codemirror.minimalSetup, EditorState.transactionFilter.of(tr => { if (tr.docChanged) { // A change is about to happen, any custom defined // before update listener should be called if (typeof this.#beforeUpdateListener == "function") { const a = []; tr.changes.iterChanges((fromA, toA, fromB, toB, inserted) => { a.push({ from: lezerUtils.positionToLocation(tr.state.doc, fromA), to: lezerUtils.positionToLocation(tr.newDoc, toB), origin: !inserted.length ? "+delete" : "+input", text: inserted.toString(), }); }); this.#beforeUpdateListener(a); } } return tr; }), ]; if (!this.config.disableSearchAddon && this.config.useSearchAddonPanel) { this.config.keyMap = this.config.keyMap ? [...this.config.keyMap, ...searchKeymap] : [...searchKeymap]; extensions.push(search({ top: true })); } if (this.config.placeholder) { extensions.push(placeholder(this.config.placeholder)); } if (this.config.keyMap) { extensions.push(Prec.highest(keymap.of(this.config.keyMap))); } if (Services.prefs.prefHasUserValue(CARET_BLINK_TIME)) { // We need to multiply the preference value by 2 to match Firefox cursor rate const cursorBlinkRate = Services.prefs.getIntPref(CARET_BLINK_TIME) * 2; extensions.push( drawSelection({ cursorBlinkRate, }) ); } const cm = new EditorView({ parent: el, extensions, }); cm.isDocumentLoadComplete = false; editors.set(this, cm); // For now, we only need to pipe the blur event cm.contentDOM.addEventListener("blur", e => this.emit("blur", e), { signal: this.#abortController?.signal, }); } /** * This creates the extension which handles marking of lines within the editor. * * @returns {object} The object contains an extension and effects which used to trigger updates to the extension * {Object} - lineContentMarkerExtension - The line content marker extension * {Object} - lineContentMarkerEffect - The effects to add and remove markers */ #createlineContentMarkersExtension() { const { codemirrorView: { Decoration, WidgetType, EditorView }, codemirrorState: { StateField, StateEffect }, } = this.#CodeMirror6; const lineContentMarkers = this.#lineContentMarkers; class LineContentWidget extends WidgetType { constructor(line, value, markerId, createElementNode) { super(); this.line = line; this.value = value; this.markerId = markerId; this.createElementNode = createElementNode; } toDOM() { return this.createElementNode(this.line, this.value); } eq(widget) { return ( widget.line == this.line && widget.markerId == this.markerId && widget.value == this.value ); } } /** * Uses the marker and current decoration list to create a new decoration list * * @param {object} marker - The marker to be used to create the new decoration * @param {Transaction} transaction - The transaction object * @param {Array} newMarkerDecorations - List of the new marker decorations being built */ function _buildDecorationsForMarker( marker, transaction, newMarkerDecorations ) { const vStartLine = transaction.state.doc.lineAt( marker._view.viewport.from ); const vEndLine = transaction.state.doc.lineAt(marker._view.viewport.to); let decorationLines; if (marker.shouldMarkAllLines) { decorationLines = []; for (let i = vStartLine.number; i <= vEndLine.number; i++) { decorationLines.push({ line: i }); } } else { decorationLines = marker.lines; } for (const { line, value } of decorationLines) { // Make sure the position is within the viewport if (line < vStartLine.number || line > vEndLine.number) { continue; } const lo = transaction.state.doc.line(line); if (marker.lineClassName) { // Markers used: // 1) blackboxed-line-marker // 2) multi-highlight-line-marker // 3) highlight-line-marker // 4) line-exception-marker // 5) debug-line-marker const classDecoration = Decoration.line({ class: marker.lineClassName, }); classDecoration.markerType = marker.id; newMarkerDecorations.push(classDecoration.range(lo.from)); } else if (marker.createLineElementNode) { // Markers used: // 1) conditional-breakpoint-panel-marker // 2) inline-preview-marker const nodeDecoration = Decoration.widget({ widget: new LineContentWidget( line, value, marker.id, marker.createLineElementNode ), // Render the widget after the cursor side: 1, block: !!marker.renderAsBlock, }); nodeDecoration.markerType = marker.id; newMarkerDecorations.push(nodeDecoration.range(lo.to)); } } } /** * This updates the decorations for the marker specified * * @param {Array} markerDecorations - The current decorations displayed in the document * @param {Array} marker - The current marker whose decoration should be update * @param {Transaction} transaction * @returns */ function updateDecorations(markerDecorations, marker, transaction) { const newDecorations = []; _buildDecorationsForMarker(marker, transaction, newDecorations); return markerDecorations.update({ // Filter out old decorations for the specified marker filter: (from, to, decoration) => { return decoration.markerType !== marker.id; }, add: newDecorations, sort: true, }); } /** * This updates all the decorations for all the markers. This * used in scenarios when an update to view (e.g vertically scrolling into a new viewport) * requires all the marker decoraions. * * @param {Array} markerDecorations - The current decorations displayed in the document * @param {Array} allMarkers - All the cached markers * @param {object} transaction * @returns */ function updateDecorationsForAllMarkers( markerDecorations, allMarkers, transaction ) { const allNewDecorations = []; for (const marker of allMarkers) { _buildDecorationsForMarker(marker, transaction, allNewDecorations); } return markerDecorations.update({ // This filters out all the old decorations filter: () => false, add: allNewDecorations, sort: true, }); } function removeDecorations(markerDecorations, markerId) { return markerDecorations.update({ filter: (from, to, decoration) => { return decoration.markerType !== markerId; }, }); } // The effects used to create the transaction when markers are // either added and removed. const addEffect = StateEffect.define(); const removeEffect = StateEffect.define(); const lineContentMarkerExtension = StateField.define({ create() { return Decoration.none; }, update(markerDecorations, transaction) { // Map the decorations through the transaction changes, this is important // as it remaps the decorations from positions in the old document to // positions in the new document. markerDecorations = markerDecorations.map(transaction.changes); for (const effect of transaction.effects) { // When a new marker is added if (effect.is(addEffect)) { markerDecorations = updateDecorations( markerDecorations, effect.value, transaction ); } else if (effect.is(removeEffect)) { // when a marker is removed markerDecorations = removeDecorations( markerDecorations, effect.value ); } else { const cachedMarkers = lineContentMarkers.values(); // For updates that are not related to this marker decoration, // we want to update the decorations when the editor is scrolled // and a new viewport is loaded. markerDecorations = updateDecorationsForAllMarkers( markerDecorations, cachedMarkers, transaction ); } } return markerDecorations; }, provide: field => EditorView.decorations.from(field), }); return { lineContentMarkerExtension, lineContentMarkerEffect: { addEffect, removeEffect }, }; } #createEventHandlers() { const eventHandlers = {}; for (const eventName in this.#editorDOMEventHandlers) { const handlers = this.#editorDOMEventHandlers[eventName]; eventHandlers[eventName] = (event, editor) => { if (!event.target) { return; } for (const handler of handlers) { // Wait a cycle so the codemirror updates to the current cursor position, // information, TODO: Currently noticed this issue with CM6, not ideal but should // investigate further Bug 1890895. event.target.ownerGlobal.setTimeout(() => { const view = editor.viewState; const cursorPos = lezerUtils.positionToLocation( view.state.doc, view.state.selection.main.head ); handler(event, view, cursorPos.line, cursorPos.column); }, 0); } }; } return eventHandlers; } /** * Adds the DOM event handlers for the editor. * * @param {object} domEventHandlers - A dictionary of handlers for the DOM events * the handlers are getting called with the following arguments * - {Object} `event`: The DOM event * - {Object} `view`: The codemirror view * - {Number} cursorLine`: The line where the cursor is currently position * - {Number} `cursorColumn`: The column where the cursor is currently position * - {Number} `eventLine`: The line where the event was fired. * This might be different from the cursor line for mouse events. * - {Number} `eventColumn`: The column where the event was fired. * This might be different from the cursor column for mouse events. */ addEditorDOMEventListeners(domEventHandlers) { const cm = editors.get(this); const { codemirrorView: { EditorView }, } = this.#CodeMirror6; // Update the cache of dom event handlers for (const eventName in domEventHandlers) { if (!this.#editorDOMEventHandlers[eventName]) { this.#editorDOMEventHandlers[eventName] = []; } this.#editorDOMEventHandlers[eventName].push(domEventHandlers[eventName]); } cm.dispatch({ effects: this.#compartments.domEventHandlersCompartment.reconfigure( EditorView.domEventHandlers(this.#createEventHandlers()) ), }); } #cacheScrollSnapshot = () => { const cm = editors.get(this); if (!this.#currentDocumentId) { return; } this.#scrollSnapshots.set(this.#currentDocumentId, cm.scrollSnapshot()); this.emitForTests("cm-editor-scrolled"); }; /** * Remove specified DOM event handlers for the editor. * * @param {object} domEventHandlers - A dictionary of handlers for the DOM events */ removeEditorDOMEventListeners(domEventHandlers) { const cm = editors.get(this); const { codemirrorView: { EditorView }, } = this.#CodeMirror6; for (const eventName in domEventHandlers) { const domEventHandler = domEventHandlers[eventName]; const cachedEventHandlers = this.#editorDOMEventHandlers[eventName]; if (!domEventHandler || !cachedEventHandlers) { continue; } const index = cachedEventHandlers.findIndex( handler => handler == domEventHandler ); this.#editorDOMEventHandlers[eventName].splice(index, 1); } cm.dispatch({ effects: this.#compartments.domEventHandlersCompartment.reconfigure( EditorView.domEventHandlers(this.#createEventHandlers()) ), }); } /** * Clear the DOM event handlers for the editor. */ #clearEditorDOMEventListeners() { const cm = editors.get(this); const { codemirrorView: { EditorView }, } = this.#CodeMirror6; this.#editorDOMEventHandlers = {}; this.#gutterDOMEventHandlers = {}; cm.dispatch({ effects: this.#compartments.domEventHandlersCompartment.reconfigure( EditorView.domEventHandlers({}) ), }); } /** * This adds a marker used to add classes to editor line based on a condition. * * @property {object} marker * The rule rendering a marker or class. * @property {object} marker.id * The unique identifier for this marker * @property {string} marker.lineClassName * The css class to apply to the line * @property {Array} marker.lines * The lines to add markers to. Each line object has a `line` and `value` property. * @property {boolean} marker.renderAsBlock * The specifies that the widget should be rendered as a block element. defaults to `false`. This is optional. * @property {boolean} marker.shouldMarkAllLines * Set to true to apply the marker to all the lines. In such case, `positions` is ignored. This is optional. * @property {Function} marker.createLineElementNode * This should return the DOM element which is used for the marker. The line number is passed as a parameter. * This is optional. */ setLineContentMarker(marker) { const cm = editors.get(this); // We store the marker an the view state, this is gives access to view data // when defining updates to the StateField. marker._view = cm; this.#lineContentMarkers.set(marker.id, marker); cm.dispatch({ effects: this.#effects.lineContentMarkerEffect.addEffect.of(marker), }); } /** * This removes the marker which has the specified className * * @param {string} markerId - The unique identifier for this marker */ removeLineContentMarker(markerId) { const cm = editors.get(this); this.#lineContentMarkers.delete(markerId); cm.dispatch({ effects: this.#effects.lineContentMarkerEffect.removeEffect.of(markerId), }); } /** * This creates the extension used to manage the rendering of markers * at specific positions with the editor. e.g used for column breakpoints * * @returns {object} The object contains an extension and effects which used to trigger updates to the extension * {Object} - positionContentMarkerExtension - The position content marker extension * {Object} - positionContentMarkerEffect - The effects to add and remove markers */ #createPositionContentMarkersExtension() { const { codemirrorView: { Decoration, EditorView, WidgetType }, codemirrorState: { StateField, StateEffect }, codemirrorLanguage: { syntaxTree }, } = this.#CodeMirror6; const cachedPositionContentMarkers = this.#posContentMarkers; class NodeWidget extends WidgetType { constructor({ line, column, isFirstNonSpaceColumn, positionData, markerId, createElementNode, customEq, }) { super(); this.line = line; this.column = column; this.isFirstNonSpaceColumn = isFirstNonSpaceColumn; this.positionData = positionData; this.markerId = markerId; this.customEq = customEq; this.toDOM = () => createElementNode(line, column, isFirstNonSpaceColumn, positionData); } eq(widget) { let eq = this.line == widget.line && this.column == widget.column && this.markerId == widget.markerId; if (this.positionData && this.customEq) { eq = eq && this.customEq(this.positionData, widget.positionData); } return eq; } } function getIndentation(lineText) { if (!lineText) { return 0; } const lineMatch = lineText.match(/^\s*/); if (!lineMatch) { return 0; } return lineMatch[0].length; } function _buildDecorationsForPositionMarkers( marker, transaction, newMarkerDecorations ) { const viewport = marker._view.viewport; const vStartLine = transaction.state.doc.lineAt(viewport.from); const vEndLine = transaction.state.doc.lineAt(viewport.to); for (const position of marker.positions) { // If codemirror positions are provided (e.g from search cursor) // compare that directly. if (position.from && position.to) { if (position.from >= viewport.from && position.to <= viewport.to) { if (marker.positionClassName) { // Markers used: // 1. active-selection-marker const classDecoration = Decoration.mark({ class: marker.positionClassName, }); classDecoration.markerType = marker.id; newMarkerDecorations.push( classDecoration.range(position.from, position.to) ); } } continue; } // If line and column are provided if ( position.line >= vStartLine.number && position.line <= vEndLine.number ) { const line = transaction.state.doc.line(position.line); // Make sure to track any indentation at the beginning of the line const column = Math.max(position.column, getIndentation(line.text)); const pos = line.from + column; if (marker.createPositionElementNode) { // Markers used: // 1. column-breakpoint-marker const isFirstNonSpaceColumn = ONLY_SPACES_REGEXP.test( line.text.substr(0, column) ); const nodeDecoration = Decoration.widget({ widget: new NodeWidget({ line: position.line, column: position.column, isFirstNonSpaceColumn, positionData: position.positionData, markerId: marker.id, createElementNode: marker.createPositionElementNode, customEq: marker.customEq, }), // Make sure the widget is rendered after the cursor // see https://codemirror.net/docs/ref/#view.Decoration^widget^spec.side for details. side: 1, }); nodeDecoration.markerType = marker.id; newMarkerDecorations.push(nodeDecoration.range(pos, pos)); } if (marker.positionClassName) { // Markers used: // 1. exception-position-marker // 2. debug-position-marker const tokenAtPos = syntaxTree(transaction.state).resolve(pos, 1); // While trying to update the markers, during content changes, the syntax tree is not // guaranteed to be complete, so there is the possibility of getting wrong `from` and `to` values for the token. // To make sure we are handling a valid token, let's check that the `from` value (which is the start position of the retrieved token) // matches the position we want. if (tokenAtPos.from !== pos) { continue; } const tokenString = line.text.slice( position.column, tokenAtPos.to - line.from ); // Ignore any empty strings and opening braces if ( tokenString === "" || tokenString === "{" || tokenString === "[" ) { continue; } const classDecoration = Decoration.mark({ class: marker.positionClassName, }); classDecoration.markerType = marker.id; newMarkerDecorations.push( classDecoration.range(pos, tokenAtPos.to) ); } } } } /** * This updates the decorations for the marker specified * * @param {Array} markerDecorations - The current decorations displayed in the document * @param {Array} marker - The current marker whose decoration should be update * @param {Transaction} transaction * @returns */ function updateDecorations(markerDecorations, marker, transaction) { const newDecorations = []; _buildDecorationsForPositionMarkers(marker, transaction, newDecorations); return markerDecorations.update({ filter: (from, to, decoration) => { return decoration.markerType !== marker.id; }, add: newDecorations, sort: true, }); } /** * This updates all the decorations for all the markers. This * used in scenarios when an update to view (e.g vertically scrolling into a new viewport) * requires all the marker decoraions. * * @param {Array} markerDecorations - The current decorations displayed in the document * @param {Array} markers - All the cached markers * @param {object} transaction * @returns */ function updateDecorationsForAllMarkers( markerDecorations, markers, transaction ) { const allNewDecorations = []; // Sort the markers iterator thanks to `displayLast` boolean. // This is typically used by the paused location marker to be shown after the column breakpoints. markers = Array.from(markers).sort((a, b) => { if (a.displayLast) { return 1; } if (b.displayLast) { return -1; } return 0; }); for (const marker of markers) { _buildDecorationsForPositionMarkers( marker, transaction, allNewDecorations ); } return markerDecorations.update({ filter: () => false, add: allNewDecorations, sort: true, }); } function removeDecorations(markerDecorations, markerId) { return markerDecorations.update({ filter: (from, to, decoration) => { return decoration.markerType !== markerId; }, }); } const addEffect = StateEffect.define(); const removeEffect = StateEffect.define(); const positionContentMarkerExtension = StateField.define({ create() { return Decoration.none; }, update(markerDecorations, transaction) { // Map the decorations through the transaction changes, this is important // as it remaps the decorations from positions in the old document to // positions in the new document. markerDecorations = markerDecorations.map(transaction.changes); for (const effect of transaction.effects) { if (effect.is(addEffect)) { // When a new marker is added markerDecorations = updateDecorations( markerDecorations, effect.value, transaction ); } else if (effect.is(removeEffect)) { // When a marker is removed markerDecorations = removeDecorations( markerDecorations, effect.value ); } else { // For updates that are not related to this marker decoration, // we want to update the decorations when the editor is scrolled // and a new viewport is loaded. markerDecorations = updateDecorationsForAllMarkers( markerDecorations, cachedPositionContentMarkers.values(), transaction ); } } return markerDecorations; }, provide: field => EditorView.decorations.from(field), }); return { positionContentMarkerExtension, positionContentMarkerEffect: { addEffect, removeEffect }, }; } /** * This adds a marker used to decorate token / content at a specific position . * * @param {object} marker * @param {string} marker.id * @param {Array} marker.positions - This includes the line / column and any optional positionData which defines each position. * @param {Function} marker.createPositionElementNode - This describes how to render the marker. * The position data (i.e line, column and positionData) are passed as arguments. * @param {Function} marker.customEq - A custom function to determine the equality of the marker. This allows the user define special conditions * for when position details have changed and an update of the marker should happen. * The positionData defined for the current and the previous instance of the marker are passed as arguments. */ setPositionContentMarker(marker) { const cm = editors.get(this); // We store the marker an the view state, this is gives access to viewport data // when defining updates to the StateField. marker._view = cm; this.#posContentMarkers.set(marker.id, marker); cm.dispatch({ effects: this.#effects.positionContentMarkerEffect.addEffect.of(marker), }); } /** * This removes the marker which has the specified id * * @param {string} markerId - The unique identifier for this marker */ removePositionContentMarker(markerId) { const cm = editors.get(this); this.#posContentMarkers.delete(markerId); cm.dispatch({ effects: this.#effects.positionContentMarkerEffect.removeEffect.of(markerId), }); } #foldGutterConfiguration() { const { codemirrorLanguage: { foldGutter }, } = this.#CodeMirror6; return foldGutter({ class: "cm6-dt-foldgutter", markerDOM: open => { if (!this.#ownerDoc) { return null; } const button = this.#ownerDoc.createElement("button"); button.classList.add("cm6-dt-foldgutter__toggle-button"); button.setAttribute("aria-expanded", open); return button; }, domEventHandlers: this.#gutterDOMEventHandlers, }); } /** * This enables the gutter and sets up all the * event listeners for the various panels in the gutter. * Currently the panels are the line numbers & code fold gutter. * * @param {object} domEventHandlers * * example usage: * const domEventHandlers = { click(event) { console.log(event);} } */ enableGutter(domEventHandlers = {}) { const cm = editors.get(this); const { codemirrorView: { lineNumbers }, } = this.#CodeMirror6; for (const eventName in domEventHandlers) { const handler = domEventHandlers[eventName]; this.#gutterDOMEventHandlers[eventName] = (view, line, event) => { line = view.state.doc.lineAt(line.from); handler(event, view, line.number); }; } this.config.lineNumbers = true; this.config.enableCodeFolding = true; cm.dispatch({ effects: [ this.#compartments.lineNumberCompartment.reconfigure( lineNumbers({ domEventHandlers: this.#gutterDOMEventHandlers }) ), this.#compartments.foldGutterCompartment.reconfigure( this.#foldGutterConfiguration() ), ], }); } /** * This removes the gutter and the panels wthin it */ disableGutter() { const cm = editors.get(this); this.config.lineNumbers = false; this.config.enableCodeFolding = false; cm.dispatch({ effects: [ this.#compartments.lineNumberCompartment.reconfigure([]), this.#compartments.foldGutterCompartment.reconfigure([]), ], }); } /** * This supports adding/removing of line classes or markers on the * line number gutter based on the defined conditions. This only supports codemirror 6. * * @param {Array} markers - The list of marker objects which defines the rules * for rendering each marker. * @property {object} marker - The rule rendering a marker or class. This is required. * @property {string} marker.id - The unique identifier for this marker. * @property {string} marker.lineClassName - The css class to add to the line. This is required. * @property {function} marker.condition - The condition that decides if the marker/class gets added or removed. * This should return `false` for lines where the marker should not be added and the * result of the condition for any other line. * @property {Function=} marker.createLineElementNode - This gets the line and the result of the condition as arguments and should return the DOM element which * is used for the marker. This is optional. */ setLineGutterMarkers(markers) { const cm = editors.get(this); if (markers) { // Cache the markers for use later. See next comment for (const marker of markers) { if (!marker.id) { throw new Error("Marker has no unique identifier"); } this.#lineGutterMarkers.set(marker.id, marker); } } // When no markers are passed, the cached markers are used to update the line gutters. // This is useful for re-rendering the line gutters when the viewport changes // (note: the visible ranges will be different) in this case, mainly when the editor is scrolled. else if (!this.#lineGutterMarkers.size) { return; } markers = Array.from(this.#lineGutterMarkers.values()); const { codemirrorView: { lineNumberMarkers, GutterMarker }, codemirrorState: { RangeSetBuilder }, } = this.#CodeMirror6; // This creates a new GutterMarker https://codemirror.net/docs/ref/#view.GutterMarker // to represents how each line gutter is rendered in the view. // This is set as the value for the Range https://codemirror.net/docs/ref/#state.Range // which represents the line. class LineGutterMarker extends GutterMarker { constructor(className, lineNumber, createElementNode, conditionResult) { super(); this.elementClass = className || null; this.lineNumber = lineNumber; this.createElementNode = createElementNode; this.conditionResult = conditionResult; this.toDOM = createElementNode ? () => createElementNode(lineNumber, conditionResult) : null; } eq(marker) { return ( marker.lineNumber == this.lineNumber && marker.conditionResult == this.conditionResult ); } } // Loop through the visible ranges https://codemirror.net/docs/ref/#view.EditorView.visibleRanges // (representing the lines in the current viewport) and generate a new rangeset for updating the line gutter // based on the conditions defined in the markers(for each line) provided. const builder = new RangeSetBuilder(); const { from, to } = cm.viewport; let pos = from; while (pos <= to) { const line = cm.state.doc.lineAt(pos); for (const { lineClassName, condition, createLineElementNode, } of markers) { if (typeof condition !== "function") { throw new Error("The `condition` is not a valid function"); } const conditionResult = condition(line.number); if (conditionResult !== false) { builder.add( line.from, line.to, new LineGutterMarker( lineClassName, line.number, createLineElementNode, conditionResult ) ); } } pos = line.to + 1; } // To update the state with the newly generated marker range set, a dispatch is called on the view // with an transaction effect created by the lineNumberMarkersCompartment, which is used to update the // lineNumberMarkers extension configuration. cm.dispatch({ effects: this.#compartments.lineNumberMarkersCompartment.reconfigure( lineNumberMarkers.of(builder.finish()) ), }); } /** * This creates the extension used to manage the rendering of markers for * results for any search pattern * * @param {RegExp} pattern - The search pattern * @param {string} className - The class used to decorate each result * @returns {Array} An extension which is an array containing the view * which manages the rendering of the line content markers. */ #searchHighlighterExtension({ /* This defaults to matching nothing */ pattern = /.^/g, className = "", }) { const cm = editors.get(this); if (!cm) { return []; } const { codemirrorView: { Decoration, ViewPlugin, EditorView, MatchDecorator }, codemirrorSearch: { RegExpCursor }, } = this.#CodeMirror6; this.searchState.query = pattern; const searchCursor = new RegExpCursor(cm.state.doc, pattern, { ignoreCase: pattern.ignoreCase, }); this.searchState.cursors = Array.from(searchCursor); this.searchState.currentCursorIndex = -1; const patternMatcher = new MatchDecorator({ regexp: pattern, decorate: (add, from, to) => { add(from, to, Decoration.mark({ class: className })); }, }); const searchHighlightView = ViewPlugin.fromClass( class { decorations; constructor(view) { this.decorations = patternMatcher.createDeco(view); } update(viewUpdate) { this.decorations = patternMatcher.updateDeco( viewUpdate, this.decorations ); } }, { decorations: instance => instance.decorations, provide: plugin => EditorView.atomicRanges.of(view => { return view.plugin(plugin)?.decorations || Decoration.none; }), } ); return [searchHighlightView]; } /** * This should add the class to the results of a search pattern specified * * @param {RegExp} pattern - The search pattern * @param {string} className - The class used to decorate each result */ highlightSearchMatches(pattern, className) { const cm = editors.get(this); cm.dispatch({ effects: this.#compartments.searchHighlightCompartment.reconfigure( this.#searchHighlighterExtension({ pattern, className }) ), }); } /** * This clear any decoration on all the search results */ clearSearchMatches() { this.highlightSearchMatches(undefined, ""); } /** * Retrieves the cursor for the next selection to be highlighted * * @param {boolean} reverse - Determines the direction of the cursor movement * @returns {RegExpSearchCursor} */ getNextSearchCursor(reverse) { if (reverse) { if (this.searchState.currentCursorIndex == 0) { this.searchState.currentCursorIndex = this.searchState.cursors.length - 1; } else { this.searchState.currentCursorIndex--; } } else if ( this.searchState.currentCursorIndex == this.searchState.cursors.length - 1 ) { this.searchState.currentCursorIndex = 0; } else { this.searchState.currentCursorIndex++; } return this.searchState.cursors[this.searchState.currentCursorIndex]; } /** * Get the start and end locations of the current viewport * * @param {number} offsetHorizontalCharacters - Offset of characters offscreen * @param {number} offsetVerticalLines - Offset of lines offscreen * @returns {object} - The location information for the current viewport */ getLocationsInViewport( offsetHorizontalCharacters = 0, offsetVerticalLines = 0 ) { if (this.isDestroyed()) { return null; } const cm = editors.get(this); let startLine, endLine, scrollLeft, charWidth, rightPosition; if (this.config.cm6) { // Report no viewport until we show an actual source (and not a loading/error message) if (!this.#currentDocumentId) { return null; } const { from, to } = cm.viewport; startLine = cm.state.doc.lineAt(from).number - offsetVerticalLines; endLine = cm.state.doc.lineAt(to).number + offsetVerticalLines; scrollLeft = cm.scrollDOM.scrollLeft; charWidth = cm.defaultCharacterWidth; rightPosition = scrollLeft + cm.dom.getBoundingClientRect().width; } else { if (!cm) { return null; } const scrollArea = cm.getScrollInfo(); const rect = cm.getWrapperElement().getBoundingClientRect(); startLine = cm.lineAtHeight(rect.top, "window") - offsetVerticalLines; endLine = cm.lineAtHeight(rect.bottom, "window") + offsetVerticalLines; scrollLeft = cm.doc.scrollLeft; charWidth = cm.defaultCharWidth(); rightPosition = scrollLeft + (scrollArea.clientWidth - 30); } return { start: { line: startLine, column: scrollLeft > 0 ? Math.floor(scrollLeft / charWidth) - offsetHorizontalCharacters : 0, }, end: { line: endLine, column: Math.floor(rightPosition / charWidth) + offsetHorizontalCharacters, }, }; } /** * Gets the position information for the current selection * * @returns {object} cursor - The location information for the current selection * cursor.from - An object with the starting line / column of the selection * cursor.to - An object with the end line / column of the selection */ getSelectionCursor() { const cm = editors.get(this); if (this.config.cm6) { const selection = cm.state.selection.ranges[0]; const lineFrom = cm.state.doc.lineAt(selection.from); const lineTo = cm.state.doc.lineAt(selection.to); return { from: { line: lineFrom.number, ch: selection.from - lineFrom.from, }, to: { line: lineTo.number, ch: selection.to - lineTo.from, }, }; } return { from: cm.getCursor("from"), to: cm.getCursor("to"), }; } /** * Gets the text content for the current selection * * @returns {string} */ getSelectedText() { const cm = editors.get(this); if (this.config.cm6) { const selection = cm.state.selection.ranges[0]; return cm.state.doc.sliceString(selection.from, selection.to); } return cm.getSelection().trim(); } /** * Given screen coordinates this should return the line and column * related. This used currently to determine the line and columns * for the tokens that are hovered over. * * @param {number} left - Horizontal position from the left * @param {number} top - Vertical position from the top * @returns {object} position - The line and column related to the screen coordinates. */ getPositionAtScreenCoords(left, top) { const cm = editors.get(this); if (this.config.cm6) { const position = cm.posAtCoords( { x: left, y: top }, // "precise", i.e. if a specific position cannot be determined, an estimated one will be used false ); const line = cm.state.doc.lineAt(position); return { line: line.number, column: position - line.from, }; } const { line, ch } = cm.coordsChar( { left, top }, // Use the "window" context where the coordinates are relative to the top-left corner // of the currently visible (scrolled) window. // This enables codemirror also correctly handle wrappped lines in the editor. "window" ); return { line: line + 1, column: ch, }; } /** * Calculates and returns the width of a single character of the input box. * This will be used in opening the popup at the correct offset. * * @returns {number | null}: Width off the "x" char, or null if the input does not exist. */ getInputCharWidth() { const cm = editors.get(this); if (this.config.cm6) { return cm.defaultCharacterWidth; } return cm.defaultCharWidth(); } /** * Check that text is selected * * @returns {boolean} */ isTextSelected() { const cm = editors.get(this); if (this.config.cm6) { const selection = cm.state.selection.ranges[0]; return selection.from !== selection.to; } return cm.somethingSelected(); } /** * Returns a boolean indicating whether the editor is ready to * use. Use appendTo(el).then(() => {}) for most cases */ isAppended() { return editors.has(this); } /** * Returns the currently active highlighting mode. * See Editor.modes for the list of all suppoert modes. */ getMode() { return this.getOption("mode"); } /** * Loads a script into editor's containing window. */ loadScript(url) { if (!this.container) { throw new Error("Can't load a script until the editor is loaded."); } const win = this.container.contentWindow.wrappedJSObject; Services.scriptloader.loadSubScript(url, win); } /** * Creates a CodeMirror Document * * @param {string} text: Initial text of the document * @param {object | string} mode: Mode of the document. See https://codemirror.net/5/doc/manual.html#option_mode * @returns CodeMirror.Doc */ createDocument(text = "", mode) { return new this.Doc(text, mode); } /** * Replaces the current document with a new source document */ replaceDocument(doc) { const cm = editors.get(this); cm.swapDoc(doc); } /** * Changes the currently used syntax highlighting mode. * * @param {object} mode - Any of the modes from Editor.modes * @returns */ setMode(mode) { if (this.config.cm6) { const cm = editors.get(this); // Fallback to using js syntax highlighting if there is none found const languageMode = this.#languageModes.has(mode) ? this.#languageModes.get(mode) : this.#languageModes.get(Editor.modes.javascript); return cm.dispatch({ effects: this.#compartments.languageCompartment.reconfigure([ languageMode, ]), }); } this.setOption("mode", mode); // If autocomplete was set up and the mode is changing, then // turn it off and back on again so the proper mode can be used. if (this.config.autocomplete) { this.setOption("autocomplete", false); this.setOption("autocomplete", true); } return null; } /** * The source editor can expose several commands linked from system and context menus. * Kept for backward compatibility with styleeditor. */ insertCommandsController() { const { insertCommandsController, } = require("resource://devtools/client/shared/sourceeditor/editor-commands-controller.js"); insertCommandsController(this); } /** * Returns text from the text area. If line argument is provided * the method returns only that line. */ getText(line) { const cm = editors.get(this); if (line == null) { return this.config.cm6 ? cm.state.doc.toString() : cm.getValue(); } const info = this.lineInfo(line); return info ? info.text : ""; } /** * Gets the text from the start postion to just before the cursor position */ getTextBeforeCursor() { const cm = editors.get(this); if (this.config.cm6) { const pos = cm.state.selection.main.head; return cm.state.sliceDoc(0, pos); } return cm.getDoc().getRange({ line: 0, ch: 0 }, cm.getCursor()); } /** * Gets the location of the cursor * * @returns {object} */ getCursorPos() { const cm = editors.get(this); if (this.config.cm6) { const pos = cm.state.selection.main.head; const line = cm.state.doc.lineAt(pos); return { line: line.number, ch: pos - line.from }; } return cm.getCursor(); } getDoc() { if (!this.config) { return null; } const cm = editors.get(this); if (this.config.cm6) { if (!this.#currentDocument) { // A key for caching the WASM content in the WeakMap this.#currentDocument = { id: this.#currentDocumentId }; } return this.#currentDocument; } return cm.getDoc(); } get isWasm() { return wasm.isWasm(this.getDoc()); } getWasmLineNumberFormatter() { return wasm.getWasmLineNumberFormatter(this.getDoc()); } wasmOffsetToLine(offset) { return wasm.wasmOffsetToLine(this.getDoc(), offset); } lineToWasmOffset(number) { return wasm.lineToWasmOffset(this.getDoc(), number); } toLineIfWasmOffset(maybeOffset) { if (typeof maybeOffset !== "number" || !this.isWasm) { return maybeOffset; } return this.wasmOffsetToLine(maybeOffset); } renderWasmText(content) { return wasm.renderWasmText(this.getDoc(), content); } /** * Gets details about the line * * @param {number} line * @returns {object} line info object */ lineInfo(line) { const cm = editors.get(this); if (this.config.cm6) { const el = this.getElementAtLine(line); return { text: el.innerText, // TODO: Expose those, or see usage for those and do things differently line: null, gutterMarkers: null, textClass: null, bgClass: null, wrapClass: el.className, widgets: null, }; } return cm.lineInfo(line); } /** * Get the functions symbols for the current source loaded in the * the editor. * * @param {number} maxResults - The maximum no of results to display */ async getFunctionSymbols(maxResults) { const cm = editors.get(this); const { codemirrorLanguage } = this.#CodeMirror6; const functionSymbols = []; let resultsCount = 0; await lezerUtils.walkTree(cm, codemirrorLanguage, { filterSet: lezerUtils.nodeTypeSets.functionsDeclAndExpr, enterVisitor: node => { if (resultsCount == maxResults) { return; } const syntaxNode = node.node; const name = lezerUtils.getFunctionName(cm.state.doc, syntaxNode); // Ignore anonymous functions if (name == null) { return; } functionSymbols.push({ name, klass: lezerUtils.getFunctionClass(cm.state.doc, syntaxNode), location: { start: lezerUtils.positionToLocation(cm.state.doc, node.from), end: lezerUtils.positionToLocation(cm.state.doc, node.to), }, parameterNames: lezerUtils.getFunctionParameterNames( cm.state.doc, syntaxNode ), identifier: null, index: node.index, }); resultsCount++; }, forceParseTo: cm.state.doc.length, }); return functionSymbols; } /** * Get the class symbols for the current source loaded in the the editor. * * @returns */ async getClassSymbols() { const cm = editors.get(this); const { codemirrorLanguage } = this.#CodeMirror6; const classSymbols = []; await lezerUtils.walkTree(cm, codemirrorLanguage, { filterSet: lezerUtils.nodeTypeSets.classes, enterVisitor: node => { const classVarDefNode = node.node.firstChild.nextSibling; classSymbols.push({ name: cm.state.doc.sliceString( classVarDefNode.from, classVarDefNode.to ), location: { start: lezerUtils.positionToLocation(cm.state.doc, node.from), end: lezerUtils.positionToLocation(cm.state.doc, node.to), }, }); }, forceParseTo: cm.state.doc.length, }); return classSymbols; } /** * Finds the best function name for the location specified. * This is used to map original function names to their corresponding * generated functions. * * @param {object} location * @returns */ async getClosestFunctionName(location) { const cm = editors.get(this); const { codemirrorLangJavascript: { javascriptLanguage }, codemirrorLanguage: { forceParsing, syntaxTree }, } = this.#CodeMirror6; let doc, tree; // If the specified source is already loaded in the editor, // codemirror has likely parsed most or all the source needed, // just leverage that const sourceId = location.source.id; if (this.#currentDocumentId === sourceId) { doc = cm.state.doc; // Parse the rest of the if needed. await forceParsing(cm, doc.length, 10000); tree = syntaxTree(cm.state); } else { // If the source is not currently loaded in the editor we will need // to explicitly parse its source text. // Note: The `loadSourceText` actions is called before this util `getClosestFunctionName` // to make sure source content is available to use. const sourceContent = this.#sources.get(location.source.id); if (!sourceContent) { console.error( `Can't find source content for ${location.source.id}, no function name can be determined` ); return ""; } // Create a codemirror document for the current source text. doc = cm.state.toText(sourceContent); tree = lezerUtils.getTree(javascriptLanguage, sourceId, sourceContent); } const token = lezerUtils.getTreeNodeAtLocation(doc, tree, location); if (!token) { return null; } const enclosingScope = lezerUtils.getEnclosingFunction(doc, token); return enclosingScope ? enclosingScope.funcName : ""; } /** * Traverse the syntaxTree and return expressions * which best match the specified token location is on our * list of accepted symbol types. * * @param {object} tokenLocation * @returns {Array} Member expression matches */ async findBestMatchExpressions(tokenLocation) { const cm = editors.get(this); const { codemirrorLanguage } = this.#CodeMirror6; const expressions = []; const line = cm.state.doc.line(tokenLocation.line); const tokPos = line.from + tokenLocation.column; await lezerUtils.walkTree(cm, codemirrorLanguage, { filterSet: lezerUtils.nodeTypeSets.expressions, enterVisitor: node => { if (node.from <= tokPos && node.to >= tokPos) { expressions.push({ type: node.name, // Computed member expressions not currently supported computed: false, expression: cm.state.doc.sliceString(node.from, node.to), location: { start: lezerUtils.positionToLocation(cm.state.doc, node.from), end: lezerUtils.positionToLocation(cm.state.doc, node.to), }, from: node.from, to: node.to, }); } }, walkFrom: line.from, walkTo: line.to, }); // There might be multiple expressions which are within the locations. // We want to match expressions based on dots before the desired token. // // ========================== EXAMPLE 1 ================================ // Full Expression: `this.myProperty.x` // Hovered Token: `myProperty` // Found Expressions: // { name: "MemberExpression", expression: "this.myProperty.x", from: 1715, to: 1732 } // { name: "MemberExpression", expression: "this.myProperty" from: 1715, to: 1730 } * // { name: "PropertyName", expression: "myProperty" from: 1720, to: 1730 } // // ========================== EXAMPLE 2 ================================== // Full Expression: `a(b).catch` // Hovered Token: `b` // Found Expressions: // { name: "MemberExpression", expression: "a(b).catch", from: 1921 to: 1931 } // { name: "VariableName", expression: "b", from: 1923 to: 1924 } * // // We sort based on the `to` make sure we return the correct property return expressions.sort((a, b) => { if (a.to < b.to) { return -1; } else if (a.to > b.to) { return 1; } return 0; }); } /** * Get all the lines which are inscope when paused a the specified location. * * @param {object} location * @param {Array} in scope lines */ async getInScopeLines(location) { const cm = editors.get(this); const { codemirrorLanguage } = this.#CodeMirror6; const functionLocations = []; await lezerUtils.walkTree(cm, codemirrorLanguage, { filterSet: lezerUtils.nodeTypeSets.functions, enterVisitor: node => { functionLocations.push({ name: node.name, start: lezerUtils.positionToLocation(cm.state.doc, node.from), end: lezerUtils.positionToLocation(cm.state.doc, node.to), }); }, forceParseTo: cm.viewport.to, }); // Sort based on the start locations so the scopes // are in the same order as in the source. const sortedLocations = scopeUtils.sortByStart(functionLocations); // Any function locations which are within the immediate function scope // of the paused location. const innerLocations = scopeUtils.getInnerLocations( sortedLocations, location ); // Any outer locations which do not contain the immediate function // of the paused location const outerLocations = sortedLocations.filter(loc => { if (innerLocations.includes(loc)) { return false; } return !scopeUtils.containsPosition(loc, location); }); const outOfScopeLines = scopeUtils.getOutOfScopeLines( scopeUtils.removeOverlapLocations(outerLocations) ); // This operation can be very costly for large files so we sacrifice a bit of readability // for performance sake. // We initialize an array with a fixed size and we'll directly assign value for lines // that are not out of scope. This is much faster than having an empty array and pushing // into it. const sourceNumLines = cm.state.doc.lines; const sourceLines = new Array(sourceNumLines); for (let i = 0; i < sourceNumLines; i++) { const line = i + 1; if (outOfScopeLines.size == 0 || !outOfScopeLines.has(line)) { sourceLines[i] = line; } } // Finally we need to remove any undefined values, i.e. the ones that were matching // out of scope lines. return sourceLines.filter(i => i != undefined); } /** * Gets all the bindings and generates the related references for * the specified platform scope and its ancestry * * @param {object} location - The currently paused location * @param {object} scope - The innermost scope node for the tree. This is provided by the * platform. * @returns {object} Binding references * Structure * ========== * { * 0: { // Levels * a: { // Binding * enumerable: true, * configurable: false * value: "foo" * refs: [{ // References * start: { line: 1, column: 4 } * end: { line: 3, column: 5 } * meta: {...} // For details see https://searchfox.org/mozilla-central/rev/ba7293cb2710f015fcd34f2b9919d00e27a9c2f6/devtools/client/shared/sourceeditor/lezer-utils.js#414-420 * }] * }, * ... * } */ async getBindingReferences(location, scope) { const cm = editors.get(this); const { codemirrorLanguage: { syntaxTree }, } = this.#CodeMirror6; const token = lezerUtils.getTreeNodeAtLocation( cm.state.doc, syntaxTree(cm.state), location ); if (!token) { return null; } let scopeNode = null; let level = 0; const bindingReferences = {}; // Walk up the scope tree and generate the bindings and references while (scope && scope.bindings) { const bindings = lezerUtils.getScopeBindings(scope.bindings); const seen = new Set(); scopeNode = lezerUtils.getParentScopeOfType( scopeNode || token, scope.type ); if (!scopeNode) { break; } await lezerUtils.walkCursor(scopeNode.node.cursor(), { filterSet: lezerUtils.nodeTypeSets.bindingReferences, enterVisitor: node => { let bindingName = cm.state.doc.sliceString(node.from, node.to); if (!(bindingName in bindings) || seen.has(bindingName)) { return; } const bindingData = bindings[bindingName]; const ref = { start: lezerUtils.positionToLocation(cm.state.doc, node.from), end: lezerUtils.positionToLocation(cm.state.doc, node.to), }; const syntaxNode = node.node; // Previews for member expressions are built of the meta property which is // reference of the child property and so on. e.g a.b.c if (syntaxNode.parent.name == lezerUtils.nodeTypes.MemberExpression) { ref.meta = lezerUtils.getMetaBindings( cm.state.doc, syntaxNode.parent ); // For member expressions use the name of the parent object as the binding name // i.e for `obj.a.b` the binding name should be `obj` bindingName = cm.state.doc.sliceString( syntaxNode.parent.from, syntaxNode.parent.to ); const dotIndex = bindingName.indexOf("."); if (dotIndex > -1) { bindingName = bindingName.substring(0, dotIndex); } } if (!bindingReferences[level]) { bindingReferences[level] = Object.create(null); } if (!bindingReferences[level][bindingName]) { // Put the binding info and related references together for // easy and efficient access. bindingReferences[level][bindingName] = { ...bindingData, refs: [], }; } bindingReferences[level][bindingName].refs.push(ref); seen.add(bindingName); }, }); if (scope.type === "function") { break; } level++; scope = scope.parent; } return bindingReferences; } /** * Retrieve variables declared in the expression from the CodeMirror state, in order * to display them in the autocomplete popup. * * @returns Array */ async getExpressionVariables() { const cm = editors.get(this); const variables = []; if (this.config.cm6) { const { codemirrorLanguage } = this.#CodeMirror6; const cursorLocation = this.getSelectionCursor(); const line = cm.state.doc.line(cursorLocation.from.line); const tokPos = line.from + cursorLocation.from.ch; await lezerUtils.walkTree(cm, codemirrorLanguage, { filterSet: lezerUtils.nodeTypeSets.variables, enterVisitor: node => { if (node.from <= tokPos && node.to >= tokPos) { variables.push(cm.state.doc.sliceString(node.from, node.to)); } }, walkFrom: line.from, walkTo: line.to, }); } else { const { state } = cm.getTokenAt(cm.getCursor()); if (state.context) { for (let c = state.context; c; c = c.prev) { for (let v = c.vars; v; v = v.next) { if (v.name) { variables.push(v.name); } } } } const keys = ["localVars", "globalVars"]; for (const key of keys) { if (state[key]) { for (let v = state[key]; v; v = v.next) { if (v.name) { variables.push(v.name); } } } } } return variables; } /** * Replaces whatever is in the text area with the contents of * the 'value' argument. * * @param {string} value: The text to replace the editor content * @param {object} options * @param {string} options.documentId * Optional unique id represeting the specific document which is source of the text. * Will be null for loading and error messages. * @param {boolean} options.saveTransactionToHistory * This determines if the transaction for this specific text change should be added to the undo/redo history. */ async setText(value, { documentId, saveTransactionToHistory = true } = {}) { const cm = editors.get(this); const isWasm = typeof value !== "string" && "binary" in value; if (documentId) { this.#currentDocumentId = documentId; } else { // Reset this ID when showing loading and error messages, // so that we keep track when an actual source is displayed this.#currentDocumentId = null; } if (isWasm) { // wasm? // binary does not survive as Uint8Array, converting from string const binary = value.binary; const data = new Uint8Array(binary.length); for (let i = 0; i < data.length; i++) { data[i] = binary.charCodeAt(i); } const { lines, done } = wasm.getWasmText(this.getDoc(), data); const MAX_LINES = 10000000; if (lines.length > MAX_LINES) { lines.splice(MAX_LINES, lines.length - MAX_LINES); lines.push(";; .... text is truncated due to the size"); } if (!done) { lines.push(";; .... possible error during wast conversion"); } if (this.config.cm6) { value = lines.join("\n"); } else { // cm will try to split into lines anyway, saving memory value = { split: () => lines }; } } if (this.config.cm6) { if (cm.state.doc.toString() == value) { return; } const { codemirrorView: { EditorView, lineNumbers }, codemirrorState: { Transaction }, } = this.#CodeMirror6; await cm.dispatch({ changes: { from: 0, to: cm.state.doc.length, insert: value }, selection: { anchor: 0 }, annotations: [Transaction.addToHistory.of(saveTransactionToHistory)], }); const effects = []; if (this.config?.lineNumbers) { const lineNumbersConfig = { domEventHandlers: this.#gutterDOMEventHandlers, }; if (isWasm) { lineNumbersConfig.formatNumber = this.getWasmLineNumberFormatter(); } effects.push( this.#compartments.lineNumberCompartment.reconfigure( this.config.lineNumbers ? lineNumbers(lineNumbersConfig) : [] ) ); } // Get the cached scroll snapshot for this source and restore // the scroll position. Note: The scroll has to be done in a seperate dispatch // (after the previous dispatch has set the document), this is because // it is required that the document the scroll snapshot is applied to // is the exact document it was saved on. const scrollSnapshot = this.#scrollSnapshots.get(documentId); effects.push( scrollSnapshot ? scrollSnapshot : EditorView.scrollIntoView(0) ); await cm.dispatch({ effects }); if (this.currentDocumentId) { // If there is no scroll snapshot explicitly cache the snapshot set as no scroll // is triggered. if (!scrollSnapshot) { this.#cacheScrollSnapshot(); } } } else { cm.setValue(value); } this.resetIndentUnit(); } addSource(id, sourceText) { this.#sources.set(id, sourceText); } clearSources(ids) { if (ids) { for (const id of ids) { this.#sources.delete(id); } } else { this.#sources.clear(); lezerUtils.clear(); } } /* Currently used only in tests */ sourcesCount() { return this.#sources.size; } /** * Reloads the state of the editor based on all current preferences. * This is called automatically when any of the relevant preferences * change. */ reloadPreferences() { // Restore the saved autoCloseBrackets value if it is preffed on. const useAutoClose = Services.prefs.getBoolPref(AUTO_CLOSE); this.setOption( "autoCloseBrackets", useAutoClose ? this.config.autoCloseBracketsSaved : false ); this.updateCodeFoldingGutter(); this.resetIndentUnit(); this.setupAutoCompletion(); } /** * Set the current keyMap for CodeMirror, and load the support file if needed. * * @param {Window} win: The window on which the keymap files should be loaded. */ setKeyMap(win) { if (this.config.isReadOnly) { return; } const keyMap = Services.prefs.getCharPref(KEYMAP_PREF); // If alternative keymap is provided, use it. if (VALID_KEYMAPS.has(keyMap)) { if (!this.#loadedKeyMaps.has(keyMap)) { Services.scriptloader.loadSubScript(VALID_KEYMAPS.get(keyMap), win); this.#loadedKeyMaps.add(keyMap); } this.setOption("keyMap", keyMap); } else { this.setOption("keyMap", "default"); } } /** * Sets the editor's indentation based on the current prefs and * re-detect indentation if we should. */ resetIndentUnit() { if (this.isDestroyed()) { return; } const cm = editors.get(this); const iterFn = (start, maxEnd, callback) => { if (!this.config.cm6) { if (this.isDestroyed()) { return; } cm.eachLine(start, maxEnd, line => { return callback(line.text); }); } else { const iterator = cm.state.doc.iterLines( start + 1, Math.min(cm.state.doc.lines, maxEnd) + 1 ); let callbackRes; do { iterator.next(); callbackRes = callback(iterator.value); } while (iterator.done !== true && !callbackRes); } }; const { indentUnit, indentWithTabs } = getIndentationFromIteration(iterFn); if (!this.config.cm6) { cm.setOption("tabSize", indentUnit); cm.setOption("indentUnit", indentUnit); cm.setOption("indentWithTabs", indentWithTabs); } else { const { codemirrorState: { EditorState }, codemirrorLanguage, } = this.#CodeMirror6; cm.dispatch({ effects: this.#compartments.tabSizeCompartment.reconfigure( EditorState.tabSize.of(indentUnit) ), }); cm.dispatch({ effects: this.#compartments.indentCompartment.reconfigure( codemirrorLanguage.indentUnit.of( (indentWithTabs ? "\t" : " ").repeat(indentUnit) ) ), }); } } /** * Replaces contents of a text area within the from/to {line, ch} * range. If neither `from` nor `to` arguments are provided works * exactly like setText. If only `from` object is provided, inserts * text at that point, *overwriting* as many characters as needed. */ replaceText(value, from, to) { const cm = editors.get(this); if (!from) { this.setText(value); return; } if (!to) { const text = cm.getRange({ line: 0, ch: 0 }, from); this.setText(text + value); return; } cm.replaceRange(value, from, to); } /** * Inserts text at the specified {line, ch} position, shifting existing * contents as necessary. */ insertText(value, at) { const cm = editors.get(this); cm.replaceRange(value, at, at); } /** * Deselects contents of the text area. */ dropSelection() { if (!this.somethingSelected()) { return; } this.setCursor(this.getCursor()); } /** * Returns true if there is more than one selection in the editor. */ hasMultipleSelections() { const cm = editors.get(this); return cm.listSelections().length > 1; } /** * Gets the first visible line number in the editor. */ getFirstVisibleLine() { const cm = editors.get(this); return cm.lineAtHeight(0, "local"); } /** * Scrolls the view such that the given line number is the first visible line. */ setFirstVisibleLine(line) { const cm = editors.get(this); const { top } = cm.charCoords({ line, ch: 0 }, "local"); cm.scrollTo(0, top); } /** * Sets the cursor to the specified {line, ch} position with an additional * option to align the line at the "top", "center" or "bottom" of the editor * with "top" being default value. */ setCursor({ line, ch }, align) { const cm = editors.get(this); this.alignLine(line, align); cm.setCursor({ line, ch }); this.emit("cursorActivity"); } /** * Aligns the provided line to either "top", "center" or "bottom" of the * editor view with a maximum margin of MAX_VERTICAL_OFFSET lines from top or * bottom. */ alignLine(line, align) { const cm = editors.get(this); const from = cm.lineAtHeight(0, "page"); const to = cm.lineAtHeight(cm.getWrapperElement().clientHeight, "page"); const linesVisible = to - from; const halfVisible = Math.round(linesVisible / 2); // If the target line is in view, skip the vertical alignment part. if (line <= to && line >= from) { return; } // Setting the offset so that the line always falls in the upper half // of visible lines (lower half for bottom aligned). // MAX_VERTICAL_OFFSET is the maximum allowed value. const offset = Math.min(halfVisible, MAX_VERTICAL_OFFSET); let topLine = { center: Math.max(line - halfVisible, 0), bottom: Math.max(line - linesVisible + offset, 0), top: Math.max(line - offset, 0), }[align || "top"] || offset; // Bringing down the topLine to total lines in the editor if exceeding. topLine = Math.min(topLine, this.lineCount()); this.setFirstVisibleLine(topLine); } /** * Returns whether a marker of a specified class exists in a line's gutter. */ hasMarker(line, gutterName, markerClass) { const marker = this.getMarker(line, gutterName); if (!marker) { return false; } return marker.classList.contains(markerClass); } /** * Adds a marker with a specified class to a line's gutter. If another marker * exists on that line, the new marker class is added to its class list. */ addMarker(line, gutterName, markerClass) { const cm = editors.get(this); const info = this.lineInfo(line); if (!info) { return; } const gutterMarkers = info.gutterMarkers; let marker; if (gutterMarkers) { marker = gutterMarkers[gutterName]; if (marker) { marker.classList.add(markerClass); return; } } marker = cm.getWrapperElement().ownerDocument.createElement("div"); marker.className = markerClass; cm.setGutterMarker(info.line, gutterName, marker); } /** * The reverse of addMarker. Removes a marker of a specified class from a * line's gutter. */ removeMarker(line, gutterName, markerClass) { if (!this.hasMarker(line, gutterName, markerClass)) { return; } this.lineInfo(line).gutterMarkers[gutterName].classList.remove(markerClass); } /** * Adds a marker with a specified class and an HTML content to a line's * gutter. If another marker exists on that line, it is overwritten by a new * marker. */ addContentMarker(line, gutterName, markerClass, content) { const cm = editors.get(this); const info = this.lineInfo(line); if (!info) { return; } const marker = cm.getWrapperElement().ownerDocument.createElement("div"); marker.className = markerClass; // eslint-disable-next-line no-unsanitized/property marker.innerHTML = content; cm.setGutterMarker(info.line, gutterName, marker); } /** * The reverse of addContentMarker. Removes any line's markers in the * specified gutter. */ removeContentMarker(line, gutterName) { const cm = editors.get(this); const info = this.lineInfo(line); if (!info) { return; } cm.setGutterMarker(info.line, gutterName, null); } getMarker(line, gutterName) { const info = this.lineInfo(line); if (!info) { return null; } const gutterMarkers = info.gutterMarkers; if (!gutterMarkers) { return null; } return gutterMarkers[gutterName]; } /** * Removes all gutter markers in the gutter with the given name. */ removeAllMarkers(gutterName) { const cm = editors.get(this); cm.clearGutter(gutterName); } /** * Handles attaching a set of events listeners on a marker. They should * be passed as an object literal with keys as event names and values as * function listeners. The line number, marker node and optional data * will be passed as arguments to the function listener. * * You don't need to worry about removing these event listeners. * They're automatically orphaned when clearing markers. */ setMarkerListeners(line, gutterName, markerClass, eventsArg, data) { if (!this.hasMarker(line, gutterName, markerClass)) { return; } const cm = editors.get(this); const marker = cm.lineInfo(line).gutterMarkers[gutterName]; for (const name in eventsArg) { const listener = eventsArg[name].bind(this, line, marker, data); marker.addEventListener(name, listener, { signal: this.#abortController?.signal, }); } } /** * Returns whether a line is decorated using the specified class name. */ hasLineClass(line, className) { const info = this.lineInfo(line); if (!info || !info.wrapClass) { return false; } return info.wrapClass.split(" ").includes(className); } /** * Sets a CSS class name for the given line, including the text and gutter. */ addLineClass(lineOrOffset, className) { const cm = editors.get(this); const line = this.toLineIfWasmOffset(lineOrOffset); cm.addLineClass(line, "wrap", className); } /** * The reverse of addLineClass. */ removeLineClass(lineOrOffset, className) { const cm = editors.get(this); const line = this.toLineIfWasmOffset(lineOrOffset); cm.removeLineClass(line, "wrap", className); } /** * Mark a range of text inside the two {line, ch} bounds. Since the range may * be modified, for example, when typing text, this method returns a function * that can be used to remove the mark. */ markText(from, to, className = "marked-text") { const cm = editors.get(this); const text = cm.getRange(from, to); const span = cm.getWrapperElement().ownerDocument.createElement("span"); span.className = className; span.textContent = text; const mark = cm.markText(from, to, { replacedWith: span }); return { anchor: span, clear: () => mark.clear(), }; } /** * Calculates and returns one or more {line, ch} objects for * a zero-based index who's value is relative to the start of * the editor's text. * * If only one argument is given, this method returns a single * {line,ch} object. Otherwise it returns an array. */ getPosition(...args) { const cm = editors.get(this); const res = args.map(ind => cm.posFromIndex(ind)); return args.length === 1 ? res[0] : res; } /** * The reverse of getPosition. Similarly to getPosition this * method returns a single value if only one argument was given * and an array otherwise. */ getOffset(...args) { const cm = editors.get(this); const res = args.map(pos => cm.indexFromPos(pos)); return args.length > 1 ? res : res[0]; } /** * Returns a {line, ch} object that corresponds to the * left, top coordinates. */ getPositionFromCoords({ left, top }) { const cm = editors.get(this); return cm.coordsChar({ left, top }); } /** * Returns true if there's something to undo and false otherwise. */ canUndo() { const cm = editors.get(this); return cm.historySize().undo > 0; } /** * Returns true if there's something to redo and false otherwise. */ canRedo() { const cm = editors.get(this); return cm.historySize().redo > 0; } /** * Marks the contents as clean and returns the current * version number. */ setClean() { const cm = editors.get(this); this.version = cm.changeGeneration(); this.#lastDirty = false; this.emit("dirty-change"); return this.version; } /** * Returns true if contents of the text area are * clean i.e. no changes were made since the last version. */ isClean() { const cm = editors.get(this); return cm.isClean(this.version); } /** * This method opens an in-editor dialog asking for a line to * jump to. Once given, it changes cursor to that line. */ jumpToLine() { const doc = editors.get(this).getWrapperElement().ownerDocument; const div = doc.createElement("div"); const inp = doc.createElement("input"); const txt = doc.createTextNode(L10N.getStr("gotoLineCmd.promptTitle")); inp.type = "text"; inp.style.width = "10em"; inp.style.marginInlineStart = "1em"; div.appendChild(txt); div.appendChild(inp); this.openDialog(div, line => { // Handle LINE:COLUMN as well as LINE const match = line.toString().match(RE_JUMP_TO_LINE); if (match) { const [, matchLine, column] = match; this.setCursor({ line: matchLine - 1, ch: column ? column - 1 : 0 }); } }); } /** * Moves the content of the current line or the lines selected up a line. */ moveLineUp() { const cm = editors.get(this); const start = cm.getCursor("start"); const end = cm.getCursor("end"); if (start.line === 0) { return; } // Get the text in the lines selected or the current line of the cursor // and append the text of the previous line. let value; if (start.line !== end.line) { value = cm.getRange( { line: start.line, ch: 0 }, { line: end.line, ch: cm.getLine(end.line).length } ) + "\n"; } else { value = cm.getLine(start.line) + "\n"; } value += cm.getLine(start.line - 1); // Replace the previous line and the currently selected lines with the new // value and maintain the selection of the text. cm.replaceRange( value, { line: start.line - 1, ch: 0 }, { line: end.line, ch: cm.getLine(end.line).length } ); cm.setSelection( { line: start.line - 1, ch: start.ch }, { line: end.line - 1, ch: end.ch } ); } /** * Moves the content of the current line or the lines selected down a line. */ moveLineDown() { const cm = editors.get(this); const start = cm.getCursor("start"); const end = cm.getCursor("end"); if (end.line + 1 === cm.lineCount()) { return; } // Get the text of next line and append the text in the lines selected // or the current line of the cursor. let value = cm.getLine(end.line + 1) + "\n"; if (start.line !== end.line) { value += cm.getRange( { line: start.line, ch: 0 }, { line: end.line, ch: cm.getLine(end.line).length } ); } else { value += cm.getLine(start.line); } // Replace the currently selected lines and the next line with the new // value and maintain the selection of the text. cm.replaceRange( value, { line: start.line, ch: 0 }, { line: end.line + 1, ch: cm.getLine(end.line + 1).length } ); cm.setSelection( { line: start.line + 1, ch: start.ch }, { line: end.line + 1, ch: end.ch } ); } /** * Intercept CodeMirror's Find and replace key shortcut to select the search input */ findOrReplace(node, isReplaceAll) { const cm = editors.get(this); const isInput = node.tagName === "INPUT"; const isSearchInput = isInput && node.type === "search"; // replace box is a different input instance than search, and it is // located in a code mirror dialog const isDialogInput = isInput && node.parentNode && node.parentNode.classList.contains("CodeMirror-dialog"); if (!(isSearchInput || isDialogInput)) { return; } if (isSearchInput || isReplaceAll) { // select the search input // it's the precise reason why we reimplement these key shortcuts node.select(); } // need to call it since we prevent the propagation of the event and // cancel codemirror's key handling cm.execCommand("findPersistent"); } /** * Intercept CodeMirror's findNext and findPrev key shortcut to allow * immediately search for next occurance after typing a word to search. */ findNextOrPrev(node, isFindPrev) { const cm = editors.get(this); const isInput = node.tagName === "INPUT"; const isSearchInput = isInput && node.type === "search"; if (!isSearchInput) { return; } const query = node.value; // cm.state.search allows to automatically start searching for the next occurance // it's the precise reason why we reimplement these key shortcuts if (!cm.state.search || cm.state.search.query !== query) { cm.state.search = { posFrom: null, posTo: null, overlay: null, query, }; } // need to call it since we prevent the propagation of the event and // cancel codemirror's key handling if (isFindPrev) { cm.execCommand("findPrev"); } else { cm.execCommand("findNext"); } } /** * Returns current font size for the editor area, in pixels. */ getFontSize() { const cm = editors.get(this); const el = cm.getWrapperElement(); const win = el.ownerDocument.defaultView; return parseInt(win.getComputedStyle(el).getPropertyValue("font-size"), 10); } /** * Sets font size for the editor area. */ setFontSize(size) { const cm = editors.get(this); cm.getWrapperElement().style.fontSize = parseInt(size, 10) + "px"; cm.refresh(); } setLineWrapping(value) { const cm = editors.get(this); if (this.config.cm6) { const { codemirrorView: { EditorView }, } = this.#CodeMirror6; cm.dispatch({ effects: this.#compartments.lineWrapCompartment.reconfigure( value ? EditorView.lineWrapping : [] ), }); } else { cm.setOption("lineWrapping", value); } this.config.lineWrapping = value; } /** * Sets an option for the editor. For most options it just defers to * CodeMirror.setOption, but certain ones are maintained within the editor * instance. */ setOption(o, v) { const cm = editors.get(this); // Save the state of a valid autoCloseBrackets string, so we can reset // it if it gets preffed off and back on. if (o === "autoCloseBrackets" && v) { this.config.autoCloseBracketsSaved = v; } if (o === "autocomplete") { this.config.autocomplete = v; this.setupAutoCompletion(); } else { cm.setOption(o, v); this.config[o] = v; } if (o === "enableCodeFolding") { // The new value maybe explicitly force foldGUtter on or off, ignoring // the prefs service. this.updateCodeFoldingGutter(); } } /** * Gets an option for the editor. For most options it just defers to * CodeMirror.getOption, but certain ones are maintained within the editor * instance. */ getOption(o) { const cm = editors.get(this); if (o === "autocomplete") { return this.config.autocomplete; } return cm.getOption(o); } /** * Sets up autocompletion for the editor. Lazily imports the required * dependencies because they vary by editor mode. * * Autocompletion is special, because we don't want to automatically use * it just because it is preffed on (it still needs to be requested by the * editor), but we do want to always disable it if it is preffed off. */ setupAutoCompletion() { if (!this.config.autocomplete && !this.initializeAutoCompletion) { // Do nothing since there is no autocomplete config and no autocompletion have // been initialized. return; } // The autocomplete module will overwrite this.initializeAutoCompletion // with a mode specific autocompletion handler. if (!this.initializeAutoCompletion) { this.extend( require("resource://devtools/client/shared/sourceeditor/autocomplete.js") ); } if (this.config.autocomplete && Services.prefs.getBoolPref(AUTOCOMPLETE)) { this.initializeAutoCompletion(this.config.autocompleteOpts); } else { this.destroyAutoCompletion(); } } getAutoCompletionText() { const cm = editors.get(this); const mark = cm .getAllMarks() .find(m => m.className === AUTOCOMPLETE_MARK_CLASSNAME); if (!mark) { return ""; } return mark.attributes["data-completion"] || ""; } setAutoCompletionText(text) { const cursor = this.getCursor(); const cm = editors.get(this); const className = AUTOCOMPLETE_MARK_CLASSNAME; cm.operation(() => { cm.getAllMarks().forEach(mark => { if (mark.className === className) { mark.clear(); } }); if (text) { cm.markText({ ...cursor, ch: cursor.ch - 1 }, cursor, { className, attributes: { "data-completion": text, }, }); } }); } /** * Gets the element at the specified codemirror offset * * @param {number} offset * @return {Element|null} */ #getElementAtOffset(offset) { const cm = editors.get(this); const el = cm.domAtPos(offset).node; if (!el) { return null; } // Text nodes do not have offset* properties, so lets use its // parent element; if (el.nodeType == nodeConstants.TEXT_NODE) { return el.parentElement; } return el; } /** * This checks if the specified position (line/column) is within the current viewport * bounds. it helps determine if scrolling should happen. * * @param {number} line - The line in the source * @param {number} column - The column in the source * @returns {boolean} */ isPositionVisible(line, column) { const cm = editors.get(this); let inXView, inYView; function withinBounds(x, min, max) { return x >= min && x <= max; } if (this.config.cm6) { const pos = this.#positionToOffset(line, column); if (pos == null) { return false; } // `coordsAtPos` returns the absolute position of the line/column location // so that we have to ensure comparing with same absolute position for // CodeMirror DOM Element. // // Note that it may return the coordinates for a column breakpoint marker // so it may still report as visible, if the marker is on the edge of the viewport // and the displayed character at line/column is actually hidden after the scrollable area. const coords = cm.coordsAtPos(pos); if (!coords) { return false; } const { x, y, width, height } = cm.dom.getBoundingClientRect(); const gutterEl = cm.dom.querySelector(".cm-gutters"); const gutterWidth = gutterEl ? gutterEl.clientWidth : 0; inXView = coords.left > x + gutterWidth && coords.right < x + width; inYView = coords.top > y && coords.bottom < y + height; } else { const { top, left } = cm.charCoords({ line, ch: column }, "local"); const scrollArea = cm.getScrollInfo(); const charWidth = cm.defaultCharWidth(); const fontHeight = cm.defaultTextHeight(); const { scrollTop, scrollLeft } = cm.doc; inXView = withinBounds( left, scrollLeft, // Note: 30 might relate to the margin on one of the scroll bar elements. // See comment https://github.com/firefox-devtools/debugger/pull/5182#discussion_r163439209 scrollLeft + (scrollArea.clientWidth - 30) - charWidth ); inYView = withinBounds( top, scrollTop, scrollTop + scrollArea.clientHeight - fontHeight ); } return inXView && inYView; } /** * Converts line/col to CM6 offset position * * @param {number} line - The line in the source * @param {number} col - The column in the source * @returns {number} */ #positionToOffset(line, col = 0) { const cm = editors.get(this); try { const offset = cm.state.doc.line(line); return offset.from + col; } catch (e) { // Line likey does not exist in viewport yet console.warn(e.message); } return null; } /** * This returns the line and column for the specified search cursor's position * * @param {RegExpSearchCursor} searchCursor * @returns {object} */ getPositionFromSearchCursor(searchCursor) { const cm = editors.get(this); const lineFrom = cm.state.doc.lineAt(searchCursor.from); return { line: lineFrom.number - 1, ch: searchCursor.to - searchCursor.match[0].length - lineFrom.from, }; } /** * Scrolls the editor to the specified codemirror position * * @param {number} position */ scrollToPosition(position) { const cm = editors.get(this); if (!this.config.cm6) { throw new Error("This function is only compatible with CM6"); } const { codemirrorView: { EditorView }, } = this.#CodeMirror6; return cm.dispatch({ effects: EditorView.scrollIntoView(position, { x: "nearest", y: "center", }), }); } /** * Scrolls the editor to the specified line and column * * @param {number} line - The line in the source * @param {number} column - The column in the source * @param {string | null} yAlign - Optional value for position of the line after the line is scrolled. * (Used by `scrollEditorIntoView` test helper) */ async scrollTo(line, column, yAlign) { if (this.isDestroyed()) { return null; } const cm = editors.get(this); if (this.config.cm6) { const { codemirrorView: { EditorView }, } = this.#CodeMirror6; if (!this.isPositionVisible(line, column)) { const offset = this.#positionToOffset(line, column); if (offset == null) { return null; } return cm.dispatch({ effects: EditorView.scrollIntoView(offset, { x: "center", y: yAlign || "center", }), }); } } else { // For all cases where these are on the first line and column, // avoid the possibly slow computation of cursor location on large bundles. if (!line && !column) { cm.scrollTo(0, 0); return null; } const { top, left } = cm.charCoords({ line, ch: column }, "local"); if (!this.isPositionVisible(line, column)) { const scroller = cm.getScrollerElement(); const centeredX = Math.max(left - scroller.offsetWidth / 2, 0); const centeredY = Math.max(top - scroller.offsetHeight / 2, 0); return cm.scrollTo(centeredX, centeredY); } } return null; } // Used only in tests setSelectionAt(start, end) { const cm = editors.get(this); if (this.config.cm6) { const from = this.#positionToOffset(start.line, start.column); const to = this.#positionToOffset(end.line, end.column); if (from == null || to == null) { return; } cm.dispatch({ selection: { anchor: from, head: to } }); } else { cm.setSelection( { line: start.line - 1, ch: start.column }, { line: end.line - 1, ch: end.column } ); } } /** * Move CodeMirror cursor to a given location. * This will also scroll the editor to the specified position. * Used only for CM6 * * @param {number} line * @param {number} column */ async setCursorAt(line, column) { await this.scrollTo(line, column); const cm = editors.get(this); const { lines } = cm.state.doc; if (line > lines) { console.error( `Trying to set the cursor on a non-existing line ${line} > ${lines}` ); return null; } const lineInfo = cm.state.doc.line(line); if (column >= lineInfo.length) { console.error( `Trying to set the cursor on a non-existing column ${column} >= ${lineInfo.length}` ); return null; } const position = lineInfo.from + column; return cm.dispatch({ selection: { anchor: position, head: position } }); } // Used only in tests getEditorFileMode() { const cm = editors.get(this); if (this.config.cm6) { return cm.contentDOM.dataset.language; } return cm.getOption("mode").name; } // Used only in tests getEditorContent() { const cm = editors.get(this); if (this.config.cm6) { return cm.state.doc.toString(); } return cm.getValue(); } isSearchStateReady() { const cm = editors.get(this); if (this.config.cm6) { return !!this.searchState.cursors; } return !!cm.state.search; } // Used only in tests getCoords(line, column = 0) { const cm = editors.get(this); if (this.config.cm6) { const offset = this.#positionToOffset(line, column); if (offset == null) { return null; } return cm.coordsAtPos(offset); } // CodeMirror is 0-based while line and column arguments are 1-based. // Pass "column=-1" when there is no column argument passed. return cm.charCoords({ line: ~~line, ch: ~~column }); } // Used only in tests // Only used for CM6 getElementAtLine(line) { const offset = this.#positionToOffset(line); const el = this.#getElementAtOffset(offset); return el.closest(".cm-line"); } // Used only in tests getSearchQuery() { const cm = editors.get(this); if (this.config.cm6) { return this.searchState.query.toString(); } return cm.state.search.query; } // Used only in tests // Gets currently selected search term getSearchSelection() { const cm = editors.get(this); if (this.config.cm6) { const cursor = this.searchState.cursors[this.searchState.currentCursorIndex]; if (!cursor) { return { text: "", line: -1, column: -1 }; } const cursorPosition = lezerUtils.positionToLocation( cm.state.doc, cursor.to ); // The lines in CM6 are 1 based return { text: cursor.match[0], line: cursorPosition.line - 1, column: cursorPosition.column, }; } const cursor = cm.getCursor(); return { text: cm.getSelection(), line: cursor.line, column: cursor.ch, }; } // Only used for CM6 getElementAtPos(line, column) { const offset = this.#positionToOffset(line, column); const el = this.#getElementAtOffset(offset); return el; } // Used only in tests getLineCount() { const cm = editors.get(this); if (this.config.cm6) { return cm.state.doc.lines; } return cm.lineCount(); } /** * Extends an instance of the Editor object with additional * functions. Each function will be called with context as * the first argument. Context is a {ed, cm} object where * 'ed' is an instance of the Editor object and 'cm' is an * instance of the CodeMirror object. Example: * * function hello(ctx, name) { * let { cm, ed } = ctx; * cm; // CodeMirror instance * ed; // Editor instance * name; // 'Mozilla' * } * * editor.extend({ hello: hello }); * editor.hello('Mozilla'); */ extend(funcs) { Object.keys(funcs).forEach(name => { const cm = editors.get(this); const ctx = { ed: this, cm, Editor }; if (name === "initialize") { funcs[name](ctx); return; } this[name] = funcs[name].bind(null, ctx); }); } isDestroyed() { return !this.config || !editors.get(this); } destroy() { if (this.config.cm6 && this.#CodeMirror6) { this.#clearEditorDOMEventListeners(); } if (this.#abortController) { this.#abortController.abort(); this.#abortController = null; } this.container = null; this.config = null; this.version = null; this.#ownerDoc = null; this.#updateListener = null; this.#beforeUpdateListener = null; this.#lineGutterMarkers.clear(); this.#lineContentMarkers.clear(); this.#scrollSnapshots.clear(); this.#languageModes.clear(); this.clearSources(); if (this.#prefObserver) { this.#prefObserver.destroy(); } // Remove the link between the document and code-mirror. const cm = editors.get(this); if (cm?.doc) { cm.doc.cm = null; } // Destroy the CM6 view if (cm?.destroy) { cm.destroy(); } this.emit("destroy"); } updateCodeFoldingGutter() { let shouldFoldGutter = this.config.enableCodeFolding; const foldGutterIndex = this.config.gutters.indexOf( "CodeMirror-foldgutter" ); const cm = editors.get(this); if (shouldFoldGutter === undefined) { shouldFoldGutter = Services.prefs.getBoolPref(ENABLE_CODE_FOLDING); } if (shouldFoldGutter) { // Add the gutter before enabling foldGutter if (foldGutterIndex === -1) { const gutters = this.config.gutters.slice(); gutters.push("CodeMirror-foldgutter"); this.setOption("gutters", gutters); } this.setOption("foldGutter", true); } else { // No code should remain folded when folding is off. if (cm) { cm.execCommand("unfoldAll"); } // Remove the gutter so it doesn't take up space if (foldGutterIndex !== -1) { const gutters = this.config.gutters.slice(); gutters.splice(foldGutterIndex, 1); this.setOption("gutters", gutters); } this.setOption("foldGutter", false); } } /** * Register all key shortcuts. */ #initSearchShortcuts(win) { const shortcuts = new KeyShortcuts({ window: win, }); const keys = ["find.key", "findNext.key", "findPrev.key"]; if (OS === "Darwin") { keys.push("replaceAllMac.key"); } else { keys.push("replaceAll.key"); } // Process generic keys: keys.forEach(name => { const key = L10N.getStr(name); shortcuts.on(key, event => this.#onSearchShortcut(name, event)); }); } /** * Key shortcut listener. */ #onSearchShortcut = (name, event) => { if (!this.#isInputOrTextarea(event.target)) { return; } const node = event.originalTarget; switch (name) { // replaceAll.key is Alt + find.key case "replaceAllMac.key": this.findOrReplace(node, true); break; // replaceAll.key is Shift + find.key case "replaceAll.key": this.findOrReplace(node, true); break; case "find.key": this.findOrReplace(node, false); break; // findPrev.key is Shift + findNext.key case "findPrev.key": this.findNextOrPrev(node, true); break; case "findNext.key": this.findNextOrPrev(node, false); break; default: console.error("Unexpected editor key shortcut", name); return; } // Prevent default for this action event.stopPropagation(); event.preventDefault(); }; /** * Check if a node is an input or textarea */ #isInputOrTextarea(element) { const name = element.tagName.toLowerCase(); return name === "input" || name === "textarea"; } /** * Parse passed code string and returns an HTML string with the same classes CodeMirror * adds to handle syntax highlighting. * * @param {Document} doc: A document that will be used to create elements * @param {string} code: The code to highlight * @returns {string} The HTML string for the parsed code */ highlightText(doc, code) { if (!doc) { return code; } const outputNode = doc.createElement("div"); if (!this.config.cm6) { this.CodeMirror.runMode(code, "application/javascript", outputNode); } else { const { codemirrorLangJavascript, lezerHighlight } = this.#CodeMirror6; const { highlightCode, classHighlighter } = lezerHighlight; function emit(text, classes) { const textNode = doc.createTextNode(text); if (classes) { const span = doc.createElement("span"); span.appendChild(textNode); span.className = classes; outputNode.appendChild(span); } else { outputNode.appendChild(textNode); } } function emitBreak() { outputNode.appendChild(doc.createTextNode("\n")); } highlightCode( code, codemirrorLangJavascript.javascriptLanguage.parser.parse(code), classHighlighter, emit, emitBreak ); } return outputNode.innerHTML; } /** * Focus the CodeMirror editor */ focus() { const cm = editors.get(this); cm.focus(); } /** * Select the whole document */ selectAll() { const cm = editors.get(this); if (this.config.cm6) { cm.dispatch({ selection: { anchor: 0, head: cm.state.doc.length }, userEvent: "select", }); } else { cm.execCommand("selectAll"); } } } // Since Editor is a thin layer over CodeMirror some methods // are mapped directly—without any changes. if (!Services.prefs.getBoolPref(PREF_CMNEXT_ENABLED)) { CM_MAPPING.forEach(name => { Editor.prototype[name] = function (...args) { const cm = editors.get(this); return cm[name].apply(cm, args); }; }); } /** * We compute the CSS property names, values, and color names to be used with * CodeMirror to more closely reflect what is supported by the target platform. * The database is used to replace the values used in CodeMirror while initiating * an editor object. This is done here instead of the file codemirror/css.js so * as to leave that file untouched and easily upgradable. */ function getCSSKeywords(cssProperties) { function keySet(array) { const keys = {}; for (let i = 0; i < array.length; ++i) { keys[array[i]] = true; } return keys; } const propertyKeywords = cssProperties.getNames(); const colorKeywords = {}; const valueKeywords = {}; propertyKeywords.forEach(property => { if (property.includes("color")) { cssProperties.getValues(property).forEach(value => { colorKeywords[value] = true; }); } else { cssProperties.getValues(property).forEach(value => { valueKeywords[value] = true; }); } }); return { propertyKeywords: keySet(propertyKeywords), colorKeywords, valueKeywords, }; } module.exports = Editor;